
من موسوعة العلوم العربية
مراجعة 20:07، 1 نوفمبر 2013 بواسطة كنان الطرح (نقاش | مساهمات) (أنشأ الصفحة ب'{{Drugbox | English = Saroglitazar | drug_name = Saroglitazar | IUPAC_name = (2''S'')-2-Ethoxy-3-[4-(2-{2-methyl-5-[4-(methylsulfanyl)phenyl]-1''H''-pyrro...')
(فرق) → مراجعة أقدم | المراجعة الحالية (فرق) | مراجعة أحدث ← (فرق)
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | English = Saroglitazar | drug_name = Saroglitazar | IUPAC_name = (2S)-2-Ethoxy-3-[4-(2-{2-methyl-5-[4-(methylsulfanyl)phenyl]-1H-pyrrol-1-yl}ethoxy)phenyl]propanoic acid | image = Saroglitazar skeletal.svg | alt = | caption =

| tradename = Lipaglyn | pregnancy_AU = | pregnancy_US = | pregnancy_category= Category C | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Prescription Only | routes_of_administration = Oral

| protein_bound = ~ 96% in human plasma | excretion = Non-renal route of elimination

| CAS_number = 495399-09-2 | ATCvet = | ATC_prefix = None | ATC_suffix = | PubChem = | ChemSpiderID = | DrugBank =

| C=25 | H=29 | N=1 | O=4 | S=1 | molecular_weight = 439.56 g/mol | smiles = CSc3ccc(cc3)-c(ccc1C)n1CCOc(cc2)ccc2CC(C(=O)O)OCC | StdInChI=1S/C25H29NO4S/c1-4-29-24(25(27)28)17-19-6-10-21(11-7-19)30-16-15-26-18(2)5-14-23(26)20-8-12-22(31-3)13-9-20/h5-14,24H,4,15-17H2,1-3H3,(H,27,28)/t24-/m0/s1 | StdInChIKey=MRWFZSLZNUJVQW-DEOSSOPVSA-N }} ساروغليتازار (Saroglitazar)


آلية التأثير

  • يحتوي على اثنين من الفئات الرئيسية لل منبهات PPAR ، والتي تشمل PPARa ( ألفا) و PPAR غاما.
  • الدواء يقوم بتخفيض آثار الدهون والجلوكوز على حد السواء في جزيء واحد.
  • يقلل من الدهون الثلاثية العالية في الدم وكذلك نسبة السكر في الدم، ويحسن من مقاومة الأنسولين.


الجرعة المعتادة: فموياً: 4 ملغ.

الأشكال الصيدلانية

متوفر الدواء على شكل لأقراص.


