كلاريثرومايسين

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | Verifiedfields = changed | verifiedrevid = 457457495 | IUPAC_name = (3R,4S,5S,6R,7R,9R,11S,12R,13S,14S)-6-{[(2S,3R,4S,6R) -4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy} -14-ethyl-12,13-dihydroxy-4-{[(2R,4S,5S,6S)-5-hydroxy -4-methoxy-4,6-dimethyloxan-2-yl]oxy}-7 -methoxy-3,5,7,9,11,13-hexamethyl -1-oxacyclotetradecane-2,10-dione | image = Clarithromycin structure.svg | width = 250 | image2 = Clarithromycin ball-and-stick.png

| tradename = Biaxin | Drugs.com = monograph | MedlinePlus = a692005 | pregnancy_category = C (USA)
B3 (Aus) | legal_status = prescription only | routes_of_administration = oral, intravenous

| bioavailability = 50% | protein_bound = low binding | metabolism = hepatic | elimination_half-life = 3-4 h

| CASNo_Ref =  YesY | CAS_number_Ref =  YesY | CAS_number = 81103-11-9 | ATC_prefix = J01 | ATC_suffix = FA09 | PubChem = 5284534 | DrugBank_Ref = قالب:Drugbankcite | DrugBank = DB01211 | ChemSpiderID_Ref =  N | ChemSpiderID = 21112273 | UNII_Ref =  YesY | UNII = H1250JIK0A | KEGG_Ref =  YesY | KEGG = D00276 | ChEMBL_Ref =  N | ChEMBL = 1741

| C=38 | H=69 | N=1 | O=13 | molecular_weight = 747.953 g/mol | smiles = O=C3O[C@H](CC)[C@](O)(C)[C@H](O)[C@H](C(=O)[C@H](C)C[C@](OC)(C)[C@H](O[C@@H]1O[C@H](C)C[C@H](N(C)C)[C@H]1O)C([C@H](O[C@@H]2O[C@H]([C@H](O)[C@](OC)(C2)C)C)[C@H]3C)C)C | StdInChI_Ref =  YesY | StdInChI = 1S/C38H69NO13/c1-15-26-38(10,45)31(42)21(4)28(40)19(2)17-37(9,47-14)33(52-35-29(41)25(39(11)12)16-20(3)48-35)22(5)30(23(6)34(44)50-26)51-27-18-36(8,46-13)32(43)24(7)49-27/h19-27,29-33,35,41-43,45H,15-18H2,1-14H3/t19-,20-,21+,22?,23-,24+,25+,26-,27+,29-,30+,31-,32+,33-,35+,36-,37-,38-/m1/s1 | StdInChIKey_Ref =  YesY | StdInChIKey = AGOYDEPGAOXOCK-LERDGGEFSA-N }}


كلاريثرومايسين Clarithromycin

الزمرة الدوائية

مضادات العوامل الانتانية.

الصيغة الكيميائية

C38H69NO13

الاستعمال

Clarithromycin.png

معالجة:

  • انتانات الجهاز التنفسي.
  • إنتان الأذن الوسطى
  • إنتانات الجلد والأنسجة الرخوة
  • السعال الديكي
  • ذات الرئة
  • التهاب السحايا
  • الجمرة الخبيثة
  • الخراجات
  • معالجة الهيليكوباكتر في بواب المعدة (لمعالجة القرحة العفجية)
  • الوقاية من الانتانات الجراحية

مضادات الاستطباب

  1. الاضطرابات الكبدية
  2. المرضى المعالجين بالتيرفينادين مع مشاكل قلبية سابقة

التداخلات الدوائية

  1. الديجوكسين
  2. الديزوبيرميد
  3. البيموزيد
  4. فالبروات
  5. مضادات الهيستامين
  6. الوارفارين
  7. الكاربامازيبين
  8. الفينيتوئين

الآثار الجانبية

  • إسهال
  • ألم بطني
  • طفح
  • إقياء
  • قهم

تحذيرات

  • الحمل والارضاع
  • القصور الكبدي: يجب انقاص الجرعة