تيامفينيكول

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | Verifiedfields = changed | verifiedrevid = 470606287 | IUPAC_name = 2,2-dichloro-N-{(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-[4-(methylsulfonyl)phenyl]ethyl}acetamide | image = Thiamphenicol_stereo.png | width = 214 | image2 = Thiamphenicol_sf.gif

| tradename = | Drugs.com = International Drug Names | pregnancy_category = ? | legal_status = none | routes_of_administration = IV, IM, oral

| bioavailability = ? | metabolism = hepatic | elimination_half-life = 5.0 hours | excretion = renal

| CAS_number_Ref =  N | CAS_number = 15318-45-3 | ATC_prefix = J01 | ATC_suffix = BA02 | ATC_supplemental = QJ51BA02 | PubChem = 27200 | DrugBank_Ref = قالب:Drugbankcite | DrugBank = DB08621 | ChemSpiderID_Ref =  YesY | ChemSpiderID = 25315 | UNII_Ref =  YesY | UNII = FLQ7571NPM | KEGG_Ref =  YesY | KEGG = D01407 | ChEBI_Ref =  YesY | ChEBI = 32215 | ChEMBL_Ref =  N | ChEMBL = 1236282

| C=12 | H=15 | Cl=2 | N=1 | O=5 | S=1 | molecular_weight = 356.223 g/mol | smiles = ClC(Cl)C(=O)N[C@@H]([C@H](O)c1ccc(cc1)S(=O)(=O)C)CO | InChI = 1/C12H15Cl2NO5S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-16)15-12(18)11(13)14/h2-5,9-11,16-17H,6H2,1H3,(H,15,18)/t9-,10-/m1/s1 | InChIKey = OTVAEFIXJLOWRX-NXEZZACHBV | StdInChI_Ref =  YesY | StdInChI = 1S/C12H15Cl2NO5S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-16)15-12(18)11(13)14/h2-5,9-11,16-17H,6H2,1H3,(H,15,18)/t9-,10-/m1/s1 | StdInChIKey_Ref =  YesY | StdInChIKey = OTVAEFIXJLOWRX-NXEZZACHSA-N }}

Thiamphenicol.png

الزمرة

الخواص

  • غير قابل للذوبان في الماء، ولكن شديد الذوبان في الدهون.
  • يستخدم في كثير من البلدان باعتبارها المضادات الحيوية البيطرية، ولكن يوجد في الصين وايطاليا لاستخدامها في البشر.
  • ميزته الأساسية أنه أقوى من الكلورامفينيكول.