
من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
رقم CAS 71109-09-6
PubChem 72158
ChemSpider 65131
كود ATC M01AE90

InChI InChI=1S/C19H22O2/c1-13(19(20)21)15-11-12-16(14-7-3-2-4-8-14)18-10-6-5-9-17(15)18/h5-6,9-14H,2-4,7-8H2,1H3,(H,20,21)
الصيغة الجزيئية C19H22O2
كتلة مولية 282.37 g mol-1
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

فيدابروفن Vedaprofen هو مضاد التهاب لا ستيروئيدي يستخدم في الطب البيطري لعلاج الألم والالتهاب بسبب اضطرابات العضلات والعظام في الكلاب والخيول ولعلاج الألم بسبب المغص عند الحصان.