
من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
PubChem 6433107
ChemSpider 4938295
كود ATC M01AH91

InChI InChI=1S/C16H13F4NO2/c1-2-8-3-4-12(9(5-8)6-13(22)23)21-16-14(19)10(17)7-11(18)15(16)20/h3-5,7,21H,2,6H2,1H3,(H,22,23)
الصيغة الجزيئية C16H134NO2
كتلة مولية 327.26 g mol-1
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

روبيناكوكسيب Robenacoxib هو عقار مضاد التهاب غير ستيروئيدي (NSAID) مستخدم في الطب البيطري للتخفيف من الألم والالتهاب في القطط والكلاب