رانبيزوليد

من موسوعة العلوم العربية
مراجعة 16:03، 1 ديسمبر 2013 بواسطة سلام المجذوب (نقاش | مساهمات) (أنشأ الصفحة ب'{{Drugbox | IUPAC_name = N-{[(5''S'')-3-(3-Fluoro-4-{4-[(5-nitro-2-furyl)methyl]-1-piperazinyl}phenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl}acetamide | image = Ranbezolid st...')
(فرق) → مراجعة أقدم | المراجعة الحالية (فرق) | مراجعة أحدث ← (فرق)
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | IUPAC_name = N-{[(5S)-3-(3-Fluoro-4-{4-[(5-nitro-2-furyl)methyl]-1-piperazinyl}phenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl}acetamide | image = Ranbezolid structure.svg | width = 280 | alt = | image2 = | width2 = | imagename = | drug_name = | caption =

| tradename = | licence_EU = | licence_US = | DailyMedID = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | dependency_liability = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = | CAS_supplemental = | ATCvet = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 496993 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 435159 | ChEMBL = 251384 | synonyms = RBX-7644

| chemical_formula = | C=21 | H=24 | Ag= | As= | Au= | B= | Bi= | Br= | Cl= | Co= | F=1 | Fe= | Gd= | I= | K= | Mn= | N=5 | Na= | O=6 | P= | Pt= | S= | C= | Se= | Sr= | Tc= | charge = | molecular_weight = 461.4 g/mol | smiles = CC(=O)NC[C@H]1CN(C(=O)O1)c2ccc(N3CCN(Cc4oc(cc4)[N+](=O)[O-])CC3)c(F)c2 | StdInChI = InChI=1S/C21H24FN5O6/c1-14(28)23-11-17-13-26(21(29)33-17)15-2-4-19(18(22)10-15)25-8-6-24(7-9-25)12-16-3-5-20(32-16)27(30)31/h2-5,10,17H,6-9,11-13H2,1H3,(H,23,28)/t17-/m0/s1 | density = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | specific_rotation = | sec_combustion = }}

رانبيزوليد Ranbezolid هو مضاد بكتيري قيد الدراسة من فئة أوكسازوليدين. هو مثبط تنافسي للمونو أمينو أوكسيداز (MAO-I).