انقر على الصورة لتطلع على بعض المساهمين في بناء الموسوعة

الفرق بين المراجعتين لصفحة: «فلورفينيكول»

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
ط (نقل Kenan صفحة Florfenicol إلى فلورفينيكول)
لا ملخص تعديل
 
سطر 1: سطر 1:
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 461100919
| IUPAC_name = 2,2-dichloro-''N''-[(1''R'',2''S'')-3-fluoro-1-hydroxy-1-(4-methanesulfonylphenyl)propan-2-yl]acetamide
| image = Florfenicol.png
<!--Clinical data-->
| tradename = 
| Drugs.com = {{drugs.com|international|florfenicol}}
| pregnancy_category = 
| legal_status = veterinary prescription only
| routes_of_administration = intramuscular, subcutaneous
<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = 
<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 73231-34-2
| ATCvet = yes
| ATC_prefix = J01
| ATC_suffix = BA90
| ATC_supplemental =  {{ATCvet|J51|BA90}}
| PubChem = 114811
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 102776
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9J97307Y1H
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D04194
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1241590
<!--Chemical data-->
| C=12 | H=14 | Cl=2 | F=1 | N=1 | O=4 | S=1
| molecular_weight = 358.21 g/mol
| smiles = ClC(Cl)C(=O)N[C@@H]([C@H](O)c1ccc(cc1)S(=O)(=O)C)CF
| InChI = 1/C12H14Cl2FNO4S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-15)16-12(18)11(13)14/h2-5,9-11,17H,6H2,1H3,(H,16,18)/t9-,10-/m1/s1
| InChIKey = AYIRNRDRBQJXIF-NXEZZACHBQ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H14Cl2FNO4S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-15)16-12(18)11(13)14/h2-5,9-11,17H,6H2,1H3,(H,16,18)/t9-,10-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = AYIRNRDRBQJXIF-NXEZZACHSA-N
| synonyms = <small>2,2-dichloro-''N''-((1''R'',2''S'')-3-fluoro-1-hydroxy-1-(4-(methylsulfonyl)phenyl)propan-2-yl)ethanamide</small>
}}
'''Florfenicol''' فلورفينيكول هو المماثل الصنعي المفلور من [[ثيامفينيكول]].
'''Florfenicol''' فلورفينيكول هو المماثل الصنعي المفلور من [[ثيامفينيكول]].



المراجعة الحالية بتاريخ 17:03، 8 ديسمبر 2013

فلورفينيكول
Systematic (IUPAC) name
2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methanesulfonylphenyl)propan-2-yl]acetamide
Clinical data
AHFS/Drugs.com International Drug Names
Pregnancy cat. ?
Legal status veterinary prescription only
Routes intramuscular, subcutaneous
Identifiers
CAS number 73231-34-2 N
ATCvet code QJ01BA90 QJ51BA90
PubChem CID 114811
ChemSpider 102776 YesY
UNII 9J97307Y1H YesY
KEGG D04194 YesY
ChEMBL CHEMBL1241590 N
Synonyms 2,2-dichloro-N-((1R,2S)-3-fluoro-1-hydroxy-1-(4-(methylsulfonyl)phenyl)propan-2-yl)ethanamide
Chemical data
Formula C12H14Cl2FNO4S 
Mol. mass 358.21 g/mol
 N (what is this?)  (verify)

Florfenicol فلورفينيكول هو المماثل الصنعي المفلور من ثيامفينيكول.

في الولايات المتحدة، يستخدم الflorfenicol حاليا لعلاج امراض الجهاز التنفسي البقري (BRD) المرتبطة بـ Mannheimia (Pasteurella) haemolytica , Pasteurella multocida , and Haemophilus somnus ، for treatment of bovine interdigital phlegmon (foot rot, acute interdigital necrobacillosis, infectious pododermatitis) associated with Fusobacterium necrophorum and Bacteroides

استخدام florfenicol في الخيول، عادة ما يسبب الاسهال. وقد ذكرت هذه الروايات المتناقلة في التقدم إلى حالات مميتة من التهاب القولون الحاد. ولذلك، ينبغي أن يقتصر استخدام مضادات الجراثيم هذه عندما تكون الخيارات الأخرى ليست متاحة.

220px-Florfenicol.png