كيتوكونازول

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | English = Ketoconazole | verifiedrevid = 457114462 | IUPAC_name = 1-[4-(4-{[(2R,4S)-2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]ethan-1-one | image = Ketoconazole2.png | width = 300 | image2 = Ketoconazole 3D balls 1jin.png | width2 = 200

| tradename = Nizoral | Drugs.com = monograph | MedlinePlus = a682816 | pregnancy_AU = B3 | pregnancy_US = C | legal_UK = POM | legal_US = OTC | routes_of_administration = Oral, topical | licence_US = Ketoconazole

| bioavailability = Variable | protein_bound = 84 to 99% | metabolism = Hepatic | elimination_half-life = Biphasic: | excretion = Biliary and renal

| CASNo_Ref =  YesY | CAS_number_Ref =  YesY | CAS_number = 65277-42-1 | ATC_prefix = J02 | ATC_suffix = AB02 | ATC_supplemental = D01AC08 G01AF11 | PubChem = 456201 | IUPHAR_ligand = 2568 | DrugBank_Ref = قالب:Drugbankcite

| DrugBank = DB01026

| ChemSpiderID_Ref =  YesY | ChemSpiderID = 401695 | UNII_Ref =  YesY | UNII = R9400W927I | KEGG_Ref =  YesY | KEGG = D00351 | ChEBI_Ref =  YesY | ChEBI = 48336 | ChEMBL_Ref =  YesY | ChEMBL = 75

| C=26 | H=28 | Cl=2 | N=4 | O=4 | molecular_weight = 531.431 g/mol | smiles = O=C(N5CCN(c4ccc(OC[C@@H]1O[C@](OC1)(c2ccc(Cl)cc2Cl)Cn3ccnc3)cc4)CC5)C | InChI = 1/C26H28Cl2N4O4/c1-19(33)31-10-12-32(13-11-31)21-3-5-22(6-4-21)34-15-23-16-35-26(36-23,17-30-9-8-29-18-30)24-7-2-20(27)14-25(24)28/h2-9,14,18,23H,10-13,15-17H2,1H3/t23-,26-/m0/s1 | InChIKey = XMAYWYJOQHXEEK-OZXSUGGEBE | StdInChI_Ref =  YesY | StdInChI = 1S/C26H28Cl2N4O4/c1-19(33)31-10-12-32(13-11-31)21-3-5-22(6-4-21)34-15-23-16-35-26(36-23,17-30-9-8-29-18-30)24-7-2-20(27)14-25(24)28/h2-9,14,18,23H,10-13,15-17H2,1H3/t23-,26-/m0/s1 | StdInChIKey_Ref =  YesY | StdInChIKey = XMAYWYJOQHXEEK-OZXSUGGESA-N }} كيتوكونازول (Ketoconazole)

الزمرة الدوائية

مضاد فطري يستخدم جهازياً وموضعياً

الاستطبابات

  • علاج الانتانات الفطرية مثل داء المبيضات والسلاق الفموي والفطار البرعمي وداء النوسجات ونظيره الشعيه الكروانيةوداء المبيضات الجلدي المخاطي المزمن وبعض الفطور الجلدية الأخرى
  • يطبق موضعياً لعلاج السعفة الجسد وسعفة الأرفاغ والسعفة المبرقشة وداء المبيضات الجلدي والتهاب الجلد المثي

الاستخدام أثناء الحمل

من المجموعة C

مضادات الاستطباب

  • فرط الحساسية لهذا المستحضر
  • لا يصلح لعلاج الانتان الفطري للجملة العصبية المركزية بسبب ضعف انتشاره فيها
  • لا يجوز إعطاءه مع تيرفينادين أو سيزابريد لأنه قد يسبب لانظميات قلبية مميتة

تحذيرات

يستخدم بحذر عند مرضى الوظيفة الكبدية، وقد ترافق استخدامه أحياناً مع سمية كبدية مميتة