ميثوسوكسيميد: الفرق بين النسختين
اذهب إلى التنقل
اذهب إلى البحث
أنشأ الصفحة ب''''ميثوكسيمايد Mesuximide''' أو '''methsuximide''' أو '''methosuximide''' ==الزمرة== مضادات الاختلاج ==الوصف== هو دو...' |
لا ملخص تعديل |
||
| سطر 1: | سطر 1: | ||
{{Drugbox | |||
| Verifiedfields = changed | |||
| verifiedrevid = 411374493 | |||
| IUPAC_name = (''RS'')-1,3-dimethyl-3-phenyl-pyrrolidine-2,5-dione | |||
| image = Mesuximide.svg | |||
| width = 150 | |||
| chirality = [[Racemic mixture]] | |||
<!--Clinical data--> | |||
| tradename = Celontin | |||
| Drugs.com = {{drugs.com|CDI|methsuximide}} | |||
| MedlinePlus = a682028 | |||
| pregnancy_US = C | |||
| legal_US = Rx-only | |||
| routes_of_administration = [[Oral administration|By mouth]] ([[Capsule (pharmacy)|capsules]]) | |||
<!--Pharmacokinetic data--> | |||
| metabolism = [[Liver|Hepatic]] ([[demethylation]] and [[glucuronidation]]) | |||
| metabolites = ''N''-desmethylmethosuximide | |||
| elimination_half-life = 1.4–2.6 hours <small>(mesuximide)</small><br>28–38 hours <small>(active metabolite)</small> | |||
| excretion = [[Urine]] | |||
<!--Identifiers--> | |||
| IUPHAR_ligand = 7228 | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 77-41-8 | |||
| ATC_prefix = N03 | |||
| ATC_suffix = AD03 | |||
| PubChem = 6476 | |||
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | |||
| DrugBank = DB05246 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 6231 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 0G76K8X6C0 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D00404 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 697 | |||
<!--Chemical data--> | |||
| C=12 | H=13 | N=1 | O=2 | |||
| molecular_weight = 203.237 g/mol | |||
| smiles = O=C2N(C(=O)CC2(c1ccccc1)C)C | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C12H13NO2/c1-12(9-6-4-3-5-7-9)8-10(14)13(2)11(12)15/h3-7H,8H2,1-2H3 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = AJXPJJZHWIXJCJ-UHFFFAOYSA-N | |||
}} | |||
'''ميثوكسيمايد Mesuximide''' | '''ميثوكسيمايد Mesuximide''' | ||
أو '''methsuximide''' أو '''methosuximide''' | أو '''methsuximide''' أو '''methosuximide''' | ||
مراجعة 09:51، 13 نوفمبر 2017
| ملف:Mesuximide.svg | |
|---|---|
| Systematic (IUPAC) name | |
| (RS)-1,3-dimethyl-3-phenyl-pyrrolidine-2,5-dione | |
| Clinical data | |
| Trade names | Celontin |
| AHFS/Drugs.com | Consumer Drug Information |
| MedlinePlus | a682028 |
| Pregnancy cat. | C (US) |
| Legal status | ℞-only (US) |
| Routes | By mouth (capsules) |
| Pharmacokinetic data | |
| Metabolism | Hepatic (demethylation and glucuronidation) |
| Half-life | 1.4–2.6 hours (mesuximide) 28–38 hours (active metabolite) |
| Excretion | Urine |
| Identifiers | |
| CAS number | 77-41-8 Yes |
| ATC code | N03AD03 |
| PubChem | CID 6476 |
| IUPHAR ligand | 7228 |
| DrugBank | DB05246 |
| ChemSpider | 6231 Yes |
| UNII | 0G76K8X6C0 Yes |
| KEGG | D00404 Yes |
| ChEMBL | CHEMBL697 Yes |
| Chemical data | |
| Formula | C12H13NO2 |
| Mol. mass | 203.237 g/mol |
| |
| ملف:X mark.svg (what is this?) (verify) | |
ميثوكسيمايد Mesuximide أو methsuximide أو methosuximide
الزمرة
الوصف
هو دواء مضاد للاختلاج سوكسينيميدي. وهو صلب راسيمي صنعته فايزر تحت اسم Petinutin (Switzerland)[1] وCelontin (United States).[2]. الفعالية العلاجية للميثوكسيمايد هي بسبب مستقلبه الفعال دوائيا N-desmethylmethosuximide، والذي يملك عمر نصفي اطول ويحقق مستويات بلازمية أعلى من المركب الأصل.[3]
الاستعمال الدوئي
السيطرة على نوبات الغيبوبة المعندة ععلى الأدوية الأخرى.[2]
مصادر
- ↑ Pfizer AG (2005). "Petinutin (Mésuximide)". Official Pfizer AG Website (in French). Archived from the original on April 22, 2005. Retrieved August 21, 2006.
- ↑ 2٫0 2٫1 Pfizer Inc. (2008). "Celontin (methsuximide capsules, USP)". Official Pfizer Inc. Website. Retrieved November 21, 2014.
- ↑ Porter RJ, Penry JK, Lacy JR, Newmark ME, Kupferberg HJ. Plasma concentrations of phensuximide, methosuximide, and their metabolites in relation to clinical efficacy. Neurology 29: 1509-1513, 1979.