
من موسوعة العلوم العربية
(بالتحويل من Lisinopril)
اذهب إلى التنقل اذهب إلى البحث

ليسينوبريل Lisinopril هو مثبط تنافسي للإنزيم المحول للأنجيوتنسين ، يمنع تحويل الأنجيوتنسين الأول للأنجيوتنسين الثاني، وهو يسبب تضيق الأوعية الدموية وبالتالي تثبيط الأنجيوتنسين الثاني يسبب استرخاء الأوعية الدموية و نقصان الضغط . الليسينوبريل يسبب تناقص ضغط الدم، والاحتفاظ بالبوتاسيوم ، وانخفاض إعادة امتصاص الصوديوم من خلال تثبيط الألدوستيرون.

{{drugbox | Verifiedfields = changed |English= Lisinopril | Watchedfields = changed | name = قالب:Lisinopril | caption = Chemical structure of lisinopril | verifiedrevid = 432833853 | IUPAC_name = N2-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-proline | image = Lisinopril Structural Formulae V.2.svg

| tradename = Prinivil, Tensopril, Zestril, Hipril | ASHP = a692051 | Drugs.com = monograph | eMedicine = lisinopril | MedlinePlus = a692051 | pregnancy_category = C (1st trimester) / D (2nd and 3rd trimester)[1] | legal_status = Rx-only | routes_of_administration = Oral

| bioavailability = approx. 25%, but wide range between individuals (6 to 60%) | protein_bound = 0 | metabolism = None | elimination_half-life = 12 hours | excretion = Eliminated unchanged in urine

| CAS_number = 83915-83-7 | ChemSpiderID_Ref =  YesY | ChemSpiderID = 4514933 | ATC_prefix = C09 | ATC_suffix = AA03 | ATC_supplemental = | ChEBI_Ref =  N | ChEBI = 43755 | PubChem = 5362119 | DrugBank_Ref =  قالب:علامة اختيار | DrugBank = APRD00560 | KEGG_Ref =  YesY | KEGG = D00362 | ChEMBL_Ref =  YesY | ChEMBL = 1237 |synonyms = (2S)-1-[(2S)-6-amino-2-{[(1S)-1-carboxy-3-phenylpropyl]amino}hexanoyl]pyrrolidine-2-carboxylic acid | UNII_Ref =  N | UNII = 7Q3P4BS2FD

| C=21 | H=31 | N=3 | O=5 | molecular_weight = 405.488 g/mol | smiles = O=C(O)[C@H]2N(C(=O)[C@@H](N[C@H](C(=O)O)CCc1ccccc1)CCCCN)CCC2 | InChIKey = RLAWWYSOJDYHDC-BZSNNMDCBR | InChI = 1/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17-,18-/m0/s1 | StdInChI_Ref =  YesY | StdInChI = 1S/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17-,18-/m0/s1 | StdInChIKey_Ref =  YesY | StdInChIKey = RLAWWYSOJDYHDC-BZSNNMDCSA-N }}

الأسماء التجارية

  1. زيستريل
  2. لينوبريل
  3. ليسينو اقراص مغلفة
  4. اوماك اقراص
  5. سينوبريل
  6. إينوبريل


مضادات الاستطباب

  • فرط الحساسية لهذا الدواء أو لأي من مثبطات الانزيم المحول أنجيوتنسين الاخرى.
  • وذمة وعائية (تاريخ تورم في الوجه والشفاه أو اللسان) لم يعرف له سبب، أو الناجمة عن تعاطي الأدوية السابقة لمثبطات الانزيم المحول أنجيوتنسين.
  • المرضى الذين يعانون من وذمة وعائية مجهولة السبب أو وراثية.


  • انخفاض ضغط الدم/الإغماء: بعض الناس قد يشعرون بالدوار الناجم عن انخفاض في ضغط الدم خلال الأيام القليلة الأولى من تناول هذا الدواء وعلى وجه الخصوص في الأول. لهذا السبب، يفضل أن تؤخذ الجرعة الأولى عند النوم.

يجب أن تأخذ الجرعة الأولى من هذا الدواء تحت إشراف طبي في المستشفى للمرضى الذين عمرهم أكثر من 70 عاما، يعانون من انخفاض ضغط الدم، وارتفاع ضغط الدم الشديد، وانخفاض مستويات سوائل أو الملح في الدم (على سبيل المثال بسبب الجفاف) ، قصور القلب غير المستقر، ومشاكل في الكلى، أو تناول جرعات عالية من أدوية مدرة للبول وأدوية مدرة للبول متعددة، أو بعض الأدوية الأخرى التي تمدد الأوعية الدموية.

على الرغم من خفض الجرعة قد تكون ضرورية، انخفاض ضغط الدم ليست سبباً لوقف استخدام مثبط مثبطات الانزيم المحول أنجيوتنسين في المستقبل وخصوصا في المرضى المصابين بقصور في القلب حيث انخفاض في ضغط الدم الانقباضي هو تأثير مرغوب فيه.

يجب تجنب القيام بمهام خطرة مثل قيادة السيارة أو تشغيل ماكينات. إذا كنت تشعر بالدوار كثيراً الكحول قد يعزز تأثير خفض ضغط الدم من هذا الدواء، والتي يمكن أن تزيد من الدوار، وربما تزيد من خطر الإغماء.

  • الوذمة الوعائية: في أي وقت خلال فترة العلاج (خصوصا بعد الجرعة الأولى) وذمة وعائية قد تحدث، في حال واجه المريض صعوبة في التنفس أو البلع، أو تورم وجهك، والشفتين واللسان والحلق واليدين والقدمين أو الكاحلين أثناء تناول هذا الدواء يجب إخبار الطبيب. و يمنع استخدام هذا الدواء في المرضى الذين يعانون من وذمة وعائية سابقة مرتبطة بالعلاج بمثبطات الانزيم المحول أنجيوتنسين.

يجب رصد ضغط الدم و وظائف الكلوي وكمية البوتاسيوم في الدم بانتظام عند اخذ هذا الدواء (فهذا الدواء قد يسبب زيادة مستويات البوتاسيوم لدى بعض المرضى).

  • السعال: السعال الجاف قد ينتج عند استخدام مثبطات الانزيم المحول أنجيوتنسين، و يحدث عادة في غضون الأشهر القليلة الأولى من العلاج، وينبغي و يتوقف في غضون 1-4 أسابيع بعد التوقف عن تناول مثبطات الانزيم المحول أنجيوتنسين . وينبغي النظر في الأسباب الأخرى للسعال (على سبيل المثال، احتقان الرئة في المرضى المصابين بقصور في القلب) واستبعادها قبل التوقف عن تناول هذا الدواء.

يستخدم بحذر في الحالات التالية :

  1. المسنين.
  2. الأطفال.
  3. تراجع وظائف الكلى.
  4. تضيق الشرايين التي تمد الدم إلى الكليتين (تضيق الشريان الكلوي)
  5. انخفاض حجم السوائل في الجسم ، على سبيل المثال بسبب العلاج مدر للبول ، وانخفاض حمية والملح ، وغسيل الكلى والاسهال والتقيؤ والجفاف.
  6. مرضى تصلب الشرايين
  7. تضيق الشريان الرئيسي في الجسم (تضيق الشريان الأورطي)
  8. تضيق واحد من الصمامات في القلب (الصمام المترالي)
  9. عضلة القلب الضخامي الانسدادي
  10. مرض السكري.
  11. الأمراض التي تؤثر في النسيج الضام، تصلب الجلد مثل الذئبة الحمراء أو التهاب المفاصل الروماتيزمية.

الحمل والارضاع

  • المرأة الحامل: لا يجب اعطائه للمرأة الحامل ، يؤثر على الجنين.
  • المرأة المرضعة: يفرز مع حليب الأم، يجب تجنبه.

الاعراض الجانبية

أعراض شائعة :

  1. الدوخة.
  2. سعال جاف.
  3. ضيق في التنفس.
  4. اضطرابات الأمعاء مثل الإسهال والإمساك والتقيؤ والغثيان أو ألم في البطن.
  5. جفاف الفم.
  6. تغيير في الطعم.
  7. طفح جلدي أو حكة.
  8. تساقط الشعر.
  9. اضطرابات النوم.


  1. تؤخذ مع أو بدون الطعام. تناوله مع الطعام إذا ما تسبب في اضطراب في المعدة.
  2. تؤخذ الجرعة الأولى عند النوم.
  3. تجنب الكحول.
  4. تجنب الاطعمة التي تحتوي على كميات من البوتاسيوم والاملاح.
  5. لا تأخذ مضادات الحموضة خلال 2 ساعة من هذا الدواء.
  6. قياس الضغط وتسجيل القراءات خصوصا في غضون 1-3 ساعات من الجرعة الأولى أو أعلى جرعة جديدة.


ليسينوبريل له تأثير اضافي مع غيره من الأدوية التي تقلل ضغط الدم ،الأدوية الأخرى التي تقلل ضغط الدم ما يلي :

  1. مضادات مستقبلات الأنجيوتنسين II، على سبيل المثال اللوسارتان
  2. السيكلوسبورين
  3. دروسبيرينون
  4. الهيبارين
  5. بدائل الملح التي تحتوي البوتاسيوم
  6. مدرات البول الحافظة للبوتاسبوم (مثل سبيرونولاكتون، تريامتيرين، أميلوريد)
  7. مكملات البوتاسيوم.
  • قد يزيد من مستوى الليثيوم في الدم .
  • كما قد يزيد من مستوى الديجوكسين في الدم .
  • قد يعزز تأثير خفض نسبة السكر في الدم من الأنسولين والأدوية المضادة لمرض السكر عن طريق الفم، وهكذا يمكن أن يزيد من مخاطر انخفاض السكر في الدم (نقص سكر الدم) يجب على مرضى السكري ترصد بدقة مستوى السكر في الدم أثناء تناول هذا الدواء، وخصوصا في الأسابيع القليلة الأولى من العلاج.
  • قد يكون هناك خطر متزايد من حدوث انخفاض في أعداد طبيعية من خلايا الدم البيضاء في الدم إذا أخذ هذا الدواء مع أي من الأدوية التالية :
  1. ألوبيورينول
  2. الآزويثوبرين
  3. بروكائيناميد

الشكل الصيدلاني

أقراص : 2.5 مغ ، 5 مغ ، 10 مغ ، 20 مغ ، 30 مغ ، 40 مغ


يخزن في درجة حرارة بين 15-30 درجة مئوية ، بعيدا عن الرطوبة و بعيدا عن متناول الأطفال .


موقع الطبي

  1. Lisinopril. The American Society of Health-System Pharmacists. وصل لهذا المسار في 3 April 2011.