كلوربروغوانيل

من موسوعة العلوم العربية
(بالتحويل من Chlorproguanil)
اذهب إلى التنقل اذهب إلى البحث
دانا حمد
المساهمة الرئيسية في هذا المقال
كلوربروغوانيل
Chlorproguanil.png
المعرفات
رقم CAS 537-21-3
PubChem 22323
ChemSpider 20950
UNII 8O3249M729 YesY
SMILES

InChI InChI=1S/C11H15Cl2N5/c1-6(2)16-10(14)18-11(15)17-7-3-4-8(12)9(13)5-7/h3-6H,1-2H3,(H5,14,15,16,17,18)
الخصائص
Molecular formula C11H15Cl2N5
Molar mass 288.18 g/mol
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

كلوربروغوانيل وهو دواء مضاد للملاريا.