سوتالول

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | English = Bosentan | verifiedrevid = 420038718 | IUPAC_name = (RS)-N-{4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl}methanesulfonamide | image = Sotalol.svg | imagename = 1 : 1 mixture (racemate) | drug_name = Sotalol

| tradename = Betapace | Drugs.com = monograph | MedlinePlus = a693010 | pregnancy_AU = | pregnancy_US = B | pregnancy_category = | legal_status = Rx-only | routes_of_administration = oral

| bioavailability = >95% | metabolism = Not metabolized[بحاجة لمصدر] | elimination_half-life = 12 hours | excretion = Renal
Lactic (In lactating females)

| CASNo_Ref =  YesY | CAS_number_Ref =  YesY | CAS_number = 3930-20-9 | ATC_prefix = C07 | ATC_suffix = AA07 | PubChem = 5253 | DrugBank_Ref = قالب:Drugbankcite | DrugBank = DB00489 | ChemSpiderID_Ref =  YesY | ChemSpiderID = 5063 | UNII_Ref =  YesY | UNII = A6D97U294I | KEGG_Ref =  YesY | KEGG = D08525 | ChEMBL_Ref =  YesY | ChEMBL = 471

| C=12 | H=20 | N=2 | O=3 | S=1 | molecular_weight = 272.3624 g/mol | smiles = O=S(=O)(Nc1ccc(cc1)C(O)CNC(C)C)C | InChI = 1/C12H20N2O3S/c1-9(2)13-8-12(15)10-4-6-11(7-5-10)14-18(3,16)17/h4-7,9,12-15H,8H2,1-3H3 | InChIKey = ZBMZVLHSJCTVON-UHFFFAOYAR | StdInChI_Ref =  YesY | StdInChI = 1S/C12H20N2O3S/c1-9(2)13-8-12(15)10-4-6-11(7-5-10)14-18(3,16)17/h4-7,9,12-15H,8H2,1-3H3 | StdInChIKey_Ref =  YesY | StdInChIKey = ZBMZVLHSJCTVON-UHFFFAOYSA-N }} سوتالول Sotalol من أدوية الجهاز القلبي الوعائي.

الزمرة الدوائية

حاجبات قنوات البوتاسيوم، المجموعة الثالثة class III.

الوصف

يعتبر من الأدوية الجديدة نسبياً، يصنف على أنه مضاد اضطراب نظم القلب من المجموعة الثالثة، مع أنه ينتمي لحد معين إلى المجموعة الثانية (حاجبات مستقبلات بيتا)، لكنه لا يعتبر علاجياً فيها.

يحتوي على مركز عدم تناظر ويستخدم كمزيج راسيمي، لذلك يعتبر من المجموعة الثالثة والثانية؛ لأن أحد الإيناتميرات (-) له تأثير حاجب لمستقبلات بيتا وحاجب لقنوات البوتاسيوم، أما الإيناتومير (+) له تأثير حاجب لقنوات البوتاسيوم مماثل للأول ولكنه أضعف كثيراً كحاجب بيتا.

الآلية

يطيل فعل الكمون، ويزيد من دور الحران refractory period للأنسجة القلبية. وهو مثالي في المجموعة الثالثة.

طرق الإيتاء

فموي.

الحرائك الدوائية

لا يستقلب في العضوية، ولا يرتبط ببروتينات البلازما، ويطرح عن طريق البول.

مصادر