أسيبوتولول

من موسوعة العلوم العربية
(بالتحويل من Acebutolol)
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | English = Acebutolol | verifiedrevid = 443362064 | IUPAC_name = (RS)-N-{3-acetyl-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}butanamide | image = Acebutolol structure.svg

| tradename = Sectral | Drugs.com = monograph | MedlinePlus = a687003 | licence_US = Acebutolol | pregnancy_AU = C | pregnancy_US = B | pregnancy_category = | legal_status = Rx-only | routes_of_administration = oral, iv

| bioavailability = 40% (range 35 to 50%) | metabolism = Hepatic | elimination_half-life = 3-4 hours (parent drug)
8-13 hours (active metabolite) | excretion = Renal: 30%
Biliary: 60%

| CASNo_Ref =  YesY | CAS_number_Ref =  YesY | CAS_number = 37517-30-9 | ATC_prefix = C07 | ATC_suffix = AB04 | PubChem = 1978 | DrugBank_Ref = قالب:Drugbankcite | DrugBank = DB01193 | ChemSpiderID_Ref =  YesY | ChemSpiderID = 1901 | UNII_Ref =  YesY | UNII = 67P356D8GH | KEGG_Ref =  YesY | KEGG = D02338 | ChEBI_Ref =  YesY | ChEBI = 2379 | ChEMBL_Ref =  YesY | ChEMBL = 642

| C=18 | H=28 | N=2 | O=4 | molecular_weight = 336.426 g/mol | smiles = O=C(Nc1ccc(OCC(O)CNC(C)C)c(c1)C(=O)C)CCC | InChI = 1/C18H28N2O4/c1-5-6-18(23)20-14-7-8-17(16(9-14)13(4)21)24-11-15(22)10-19-12(2)3/h7-9,12,15,19,22H,5-6,10-11H2,1-4H3,(H,20,23) | InChIKey = GOEMGAFJFRBGGG-UHFFFAOYAG | StdInChI_Ref =  YesY | StdInChI = 1S/C18H28N2O4/c1-5-6-18(23)20-14-7-8-17(16(9-14)13(4)21)24-11-15(22)10-19-12(2)3/h7-9,12,15,19,22H,5-6,10-11H2,1-4H3,(H,20,23) | StdInChIKey_Ref =  YesY | StdInChIKey = GOEMGAFJFRBGGG-UHFFFAOYSA-N | melting_point = 121 }} أسيبوتولول (acebutolol) حاصر بيتا لعلاج ارتفاع ضغط الدم وعدم انتظام ضربات القلب.

الاستطباب

ارتفاع ضغط الدم. عدم انتظام ضربات القلب البطيني والأذيني. احتشاء عضلة القلب الحاد في المرضى ذات الخطورة العالية. متلازمة سميث Magenis.

مضادات الاستطباب

الذبحة الصدرية المستقرة أو غير المستقرة.

الحركية الدوائية

  • الاستقلاب: كبدي.
  • يمتص جيدا من الجهاز الهضمي.
  • التوافر البيولوجي فقط من 35٪ إلى 50٪.
  • يصل إلى ذروة مستويات البلازما في حدود 2 إلى 2.5 ساعة بعد الجرعة الفموية.
  • العمر النصفي: من 3 إلى 4 ساعات.

المشاركة الدوائية

أسيبوتولول مناسب لعلاج ارتفاع الضغط الدموي بالمشاركة مع مدرات البول.

  • ثبت أن أسيبوتولول لوحده غير كافي.

الجرعة

  • الجرعة اليومية: 200mg - 1,200mg في جرعة واحدة أو مقسمة على جرعتين وفقا لما تمليه شدة الحالة المراد علاجها.
  • ينبغي الشروع في العلاج بجرعات منخفضة.
  • يجب زيادة الجرعة بحذر وفقا لاستجابة المريض.
  • في بعض البلدان يوجد على شكل حقن I.V 25mg، ولكن هذه ليست سوى لحالات الطوارئ تحت المراقبة السريرية الصارمة.
  • الجرعة الأولى هي 12.5 إلى 25 mg، ولكن يمكن زيادة جرعات إضافية 75 إلى 100 mg، إذا لزم الأمر.
  • إذا كان مطلوب مزيد من العلاج، ينبغي أن يكون عن طريق الفم.

المصادر

https://en.wikipedia.org/wiki/Acebutolol