الفرق بين المراجعتين ل"كروكونازول"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب'{{Drugbox | IUPAC_name = 1-(1-{2-[(3-chlorophenyl)methoxy]phenyl}ethenyl)-1''H''-imidazole | image = Croconazole.png <!--Clinical data--> | tradename = | Drugs.com = ...')
(أنشأ الصفحة ب'{{Drugbox | IUPAC_name = 1-(1-{2-[(3-chlorophenyl)methoxy]phenyl}ethenyl)-1''H''-imidazole | image = Croconazole.png <!--Clinical data--> | tradename = | Drugs.com = ...')
(لا فرق)

المراجعة الحالية بتاريخ 16:39، 18 يوليو 2013

{{Drugbox | IUPAC_name = 1-(1-{2-[(3-chlorophenyl)methoxy]phenyl}ethenyl)-1H-imidazole | image = Croconazole.png

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Rx-only | routes_of_administration = Topical

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 77175-51-0 | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | PubChem = 2880 | DrugBank = | ChemSpiderID = 2777 | UNII_Ref =  YesY | UNII = 446254H55G | KEGG = D07752 | ChEMBL = 27289

| chemical_formula = | C=18 | H=15 | Cl=1 | N=2 | O=1 | molecular_weight = 310.77 g/mol | smiles = Clc1cccc(c1)COc3c(\C(=C)n2ccnc2)cccc3 | InChI = 1/C18H15ClN2O/c1-14(21-10-9-20-13-21)17-7-2-3-8-18(17)22-12-15-5-4-6-16(19)11-15/h2-11,13H,1,12H2 | InChIKey = WHPAGCJNPTUGGD-UHFFFAOYAC }}

كروكونازول Croconazole هو مضاد فطري من مشتقات الايميدازول.