
من موسوعة العلوم العربية
مراجعة 14:33، 17 يوليو 2013 بواسطة كنان الطرح (نقاش | مساهمات) (←‏المصدر)
(فرق) → مراجعة أقدم | المراجعة الحالية (فرق) | مراجعة أحدث ← (فرق)
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | Verifiedfields = changed | verifiedrevid = 457130635 | IUPAC_name = N-[(3S,6S,9S,11R,15S,18S,20R,21R,24S,25S,26S)- 6-[(1S,2R)-1,2-dihydroxy- 2-(4-hydroxyphenyl)ethyl]- 11,20,21,25-tetrahydroxy- 3,15-bis[(1R)-1-hydroxyethyl]- 26-methyl- 2,5,8,14,17,23-hexaoxo- 1,4,7,13,16,22-hexaazatricyclo [,13] heptacosan-18-yl]- 4-{4-[4-(pentyloxy)phenyl]phenyl}benzamide | image = Anidulafungin structure.svg | width = 300px

| tradename = Eraxis | Drugs.com = monograph

| protein_bound = 84 % | elimination_half-life = 40-50 hours

| CASNo_Ref =  YesY | CAS_number_Ref =  YesY | CAS_number = 166663-25-8 | ATC_prefix = J02 | ATC_suffix = AX06 | PubChem = 166548 | DrugBank_Ref =  قالب:علامة اختيار

| DrugBank = DB00362

| ChemSpiderID_Ref =  YesY | ChemSpiderID = 21106258 | UNII_Ref =  YesY | UNII = 9HLM53094I | KEGG_Ref =  N | KEGG = D03211 | ChEMBL_Ref =  N | ChEMBL = 1201126

| C=58 | H=73 | N=7 | O=17 | molecular_weight = 1140.24 g/mol | smiles = CCCCCOc1ccc(cc1)c2ccc(cc2)c3ccc(cc3)C(=O)N[C@H]6C[C@@H](O)[C@@H](O)NC(=O)C4[C@@H](O)[C@@H](C)CN4C(=O)C(NC(=O)C(NC(=O)C5C[C@@H](O)CN5C(=O)C(NC6=O)[C@@H](C)O)[C@@H](O)[C@H](O)c7ccc(O)cc7)[C@@H](C)O | StdInChI_Ref =  YesY | StdInChI = 1S/C58H73N7O17/c1-5-6-7-24-82-40-22-18-35(19-23-40)33-10-8-32(9-11-33)34-12-14-37(15-13-34)51(74)59-41-26-43(70)54(77)63-56(79)47-48(71)29(2)27-65(47)58(81)45(31(4)67)61-55(78)46(50(73)49(72)36-16-20-38(68)21-17-36)62-53(76)42-25-39(69)28-64(42)57(80)44(30(3)66)60-52(41)75/h8-23,29-31,39,41-50,54,66-73,77H,5-7,24-28H2,1-4H3,(H,59,74)(H,60,75)(H,61,78)(H,62,76)(H,63,79)/t29-,30+,31+,39+,41-,42?,43+,44?,45?,46?,47?,48-,49+,50+,54+/m0/s1 | StdInChIKey_Ref =  YesY | StdInChIKey = JHVAMHSQVVQIOT-QZNDWXLFSA-N }}

الاستعمال والإعطاء

انيدولافانغين (Anidulafungin) هو مضاد فطري من زمرة ايكينوكاندين فعال ضد الرشاشيات Aspergillus و أنواع المبيضات البيض Candida spp. يستخدم في معالجة المبيضات في الدم، داء المبيضات المريئي، والأنواع الأخرى من داء المبيضات الغازية. يعطى انيدولافانغين عبر التسريب الوريدي، المعدل الذي يجب ألا يتم تجاوزه هو 1.1 مغ/دقيقة. جرعة التحميل لداء المبيضات في الدم و داء المبيضات الأخرى الغازية هي 200 مغ تعطى في اليوم الأول متبوعةً بـ 100 مغ يومياً بعد ذلك. جرعة التحميل لداء المبيضات المريئي هي 100 مغ متبوعةً بـ 50 مغ يومياً.

آلية التأثير

يثبط انيدولافانغين تصنيع الغلوكان، وهو أنزيم مهم لتشكيل بيتا (1،3)- د – غلوكان β (1,3)-D-glucan وهو مكون رئيسي في جدار الخلية الفطرية. تصنيع الغلوكان غير موجود في الخلايا الثديية ولذلك فهو هدف جذاب للفعالية المضادة للفطريات.

نصف التصنيع

انيدولافانغين مصنع عبر نصف التصنيع. المادة البدئية هي ايكينوكاندين ب echinocandin B ، وهو مركب الاختمار للرشاشيات المعششة Aspergillus nidulans، ملحوقاً بثلاث خطوات تصنيعية.

الحرائك الدوائية

تتحقق التراكيز البلازمية الثابتة لانيدولافانغين بعد جرعة التحميل الأولى، التصفية الجهازية هي تقريباً 1 ليتر/ساعة و نصف عمر الإطراح النهائي هو 40-50 ساعة. يرتبط انيدولافانغين حوالي 84% لبروتينات البلازما و حجم الإطراح هو 30 إلى 50 ليتر. لا يستقلب، ولكنه يخضع للتدرك الكيميائي البطيء إلى ببتيدات متدركة غير فعالة. يطرح أقل من 10% من الدواء السليم في البراز وأقل من 1% يطرح في البول.

التأثيرات الجانبية والاحتياطات

كما هو الحال بالنسبة ل كاسبوفانغين (انظر كاسبوفانغين) لا يتطلب تعديل الجرعة عند مرضى الفشل الكلوي أو الفشل الكبدي.


يتوقع القليل من التداخلات الدوائية مع انيدولافانغين، حيث أنه لا يستقلب بوساطة نظام السيتوكروم P450 الكبدي وتقريباً لا يحدث تصفية كلوية.

التأثير المضاد للجراثيم:

كما هو الحال بالنسبة لـ كاسبوفانغين ( انظر كاسبوفانغين).
