الفرق بين المراجعتين ل"امورولفين"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(لا فرق)

المراجعة الحالية بتاريخ 17:33، 14 أغسطس 2013

{{Drugbox | verifiedrevid = 443386467 | IUPAC_name = (±)-(2R*,6S*)-2,6-dimethyl-4-{2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl}morpholine | image = Amorolfine.svg

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 78613-35-1 | ATC_prefix = D01 | ATC_suffix = AE16 | PubChem = 54260 | DrugBank_Ref =  قالب:علامة اختيار | DrugBank = | ChemSpiderID_Ref =  YesY | ChemSpiderID = 49010 | UNII_Ref =  YesY | UNII = AB0BHP2FH0 | KEGG_Ref =  YesY | KEGG = D02923 | ChEBI_Ref =  YesY | ChEBI = 599440 | ChEMBL_Ref =  YesY | ChEMBL = 489411

| C=21 | H=35 | N=1 | O= | molecular_weight = 317.509 g/mol | smiles = O2[C@@H](CN(CC(C)Cc1ccc(cc1)C(C)(C)CC)C[C@@H]2C)C | InChI = 1/C21H35NO/c1-7-21(5,6)20-10-8-19(9-11-20)12-16(2)13-22-14-17(3)23-18(4)15-22/h8-11,16-18H,7,12-15H2,1-6H3/t16?,17-,18+ | InChIKey = MQHLMHIZUIDKOO-AYHJJNSGBZ | StdInChI_Ref =  YesY | StdInChI = 1S/C21H35NO/c1-7-21(5,6)20-10-8-19(9-11-20)12-16(2)13-22-14-17(3)23-18(4)15-22/h8-11,16-18H,7,12-15H2,1-6H3/t16?,17-,18+ | StdInChIKey_Ref =  YesY | StdInChIKey = MQHLMHIZUIDKOO-AYHJJNSGSA-N }} أمورولفين (Amorolfine)

التأثيرات العكسية

تهيج جلدي، تتظاهر كالحمامى، الحكة، أو حس الحرق، و ظهرت نارداً تفاعلات جلدية أكثر شدة بعد التطبيق الموضعي للامورولفين.

التأثير المضاد للجراثيم

امورولفين هو مشتق للمورفولين مع فعالية مضادة للفطريات. يبدو أنه يؤثر عبر التداخل مع تصنيع الستيرولات الأساسية لعمل جدار الخلية الفطرية. امورولفين فعال في الزجاج ضد مجموعة متنوعة واسعة من الفطريات الممرضة والانتهازية متضمنةً الفطريات الجلدية، البرعمية الملهبة للجلد Blastomyces dermatitidis ،أنواع المبيضات Candida spp ،النوسجة Histoplasma ، المغمدة capsulatum ، و الشعرية المبوغة الشنكية Sporothrix schenckii .

لديه أيضاً فعالية متنوعة ضد أنواع الرشاشيات Aspergillus spp . على كل حال، على عكس فعاليته في الزجاج، فإن اموروفلين غير فعال عندما يعطى جهازياً وهذه يحد من استعماله إلى التطبيق الموضعي الإنتانات السطحية.

الاستعمال والإعطاء

اموروفلين هو مشتق للمورفولين يطبق موضعياُ على شكل هيدروكلورايد في معالجة الظفر الفطري والإنتانات الجلدية.الامتصاص الجهازي بعد التطبيق الموضعي جدير بالإهمال.

لمعالجة إنتانات الأظافر المسببة بخمائر الفطور الجلدية، و العفن فإن ورنيش محتوِ على ما يعادل 5% اموورفلين يطلى على الظفر المتأثر مرة واحدة وأحياناً مرتين في الأسبوع حتى يعاد تشكيل الظفر. تحتاج المعالجة عادةً أن تستمر من 6 إلى 12 شهر.

لإنتانات الجلد، متضمنة إنتانات الفطور الجلدية، يطبق كريم يحتوي على ما يعادل 0.25% اموروفلين مرة واحدة يومياً لمدة على الأقل 2 إلى 3 أسابيع ( تصل إلى 6 أسابيع في إنتانات القدم) ويستمر إلى 3-5 أيام بعد تحقق الشفاء السريري.


Martindale 36 2009