بروميتازين: الفرق بين النسختين
اذهب إلى التنقل
اذهب إلى البحث
كنان الطرح (نقاش | مساهمات) |
لا ملخص تعديل |
||
| سطر 1: | سطر 1: | ||
{{Drugbox | |||
| Watchedfields = changed | |||
| verifiedrevid = 462079943 | |||
| IUPAC_name = (''RS'')-''N,N''-dimethyl-1-(10''H''-phenothiazin-10-yl)propan-2-amine | |||
| image = Promethazine.svg | |||
| width = 125 <!-- image is quite low res, so don't over enlarge --> | |||
| caption = 1:1 mixture (racemate) | |||
| drug_name = Promethazine | |||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = {{drugs.com|monograph|promethazine-hydrochloride}} | |||
| MedlinePlus = a682284 | |||
| pregnancy_AU = C | |||
| pregnancy_US = C | |||
| pregnancy_category = | |||
| legal_AU = | |||
| legal_UK = | |||
| legal_US = Rx-only | |||
| legal_status = <br />(injection POM<small>([[United Kingdom|UK]])</small>) | |||
| routes_of_administration = Oral, [[suppository|rectal]], [[intravenous therapy|IV]], [[intramuscular injection|IM]], [[topical]] | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = 88% absorbed but after first-pass metabolism reduced to 25% absolute bioavailability<ref name="pmid10965395">{{cite journal | author = Strenkoski-Nix LC, Ermer J, DeCleene S, Cevallos W, Mayer PR | title = Pharmacokinetics of promethazine hydrochloride after administration of rectal suppositories and oral syrup to healthy subjects | journal = American Journal of Health-system Pharmacy : AJHP : Official Journal of the American Society of Health-System Pharmacists | volume = 57 | issue = 16 | pages = 1499–505 | year = 2000 | month = August | pmid = 10965395 | doi = | url = http://www.ajhp.org/cgi/pmidlookup?view=long&pmid=10965395}}</ref> | |||
| protein_bound = 93% | |||
| metabolism = [[Liver|Hepatic]] [[glucuronidation]] and [[sulfoxide|sulfoxidation]] | |||
| elimination_half-life = 16-19 hours<ref name="pmid10965395" /><ref name="pmid2866055">{{cite journal | author = Paton DM, Webster DR | title = Clinical pharmacokinetics of H1-receptor antagonists (the antihistamines) | journal = Clinical Pharmacokinetics | volume = 10 | issue = 6 | pages = 477–97 | year = 1985 | pmid = 2866055 | doi = 10.2165/00003088-198510060-00002| url = http://content.wkhealth.com/linkback/openurl?issn=0312-5963&volume=10&issue=6&spage=477}}</ref> | |||
| excretion = [[Kidney|Renal]] and biliary | |||
<!--Identifiers--> | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 60-87-7 | |||
| CAS_supplemental = <br/>58-33-3 (hydrochloride) <!-- Also CAS verified --> | |||
| ATC_prefix = D04 | |||
| ATC_suffix = AA10 | |||
| ATC_supplemental = {{ATC|R06|AD02}}, {{ATC|R06|AD05}} | |||
| PubChem = 4927 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = DB01069 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 4758 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = FF28EJQ494 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D00494 | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| ChEBI = 8461 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 643 | |||
<!--Chemical data--> | |||
| C = 17 | H = 20 | N = 2 | S = 1 | |||
| molecular_weight = 284.42 [[gram|g]]/[[mole (unit)|mol]] | |||
| smiles = S2c1ccccc1N(c3c2cccc3)CC(N(C)C)C | |||
| InChI = 1/C17H20N2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 | |||
| InChIKey = PWWVAXIEGOYWEE-UHFFFAOYAG | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C17H20N2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = PWWVAXIEGOYWEE-UHFFFAOYSA-N | |||
}} | |||
[[ملف:Promethazine.png |thumb|200px]] | [[ملف:Promethazine.png |thumb|200px]] | ||
'''بروميتازين (Promethazine)''' | '''بروميتازين (Promethazine)''' | ||
| سطر 41: | سطر 104: | ||
*يؤدي أحياناً إلى الحصول على نتائج إيجابية أو سلبية كاذبة في بعض اختبارات الحمل. | *يؤدي أحياناً إلى الحصول على نتائج إيجابية أو سلبية كاذبة في بعض اختبارات الحمل. | ||
==مصادر== | |||
{{ثبت المراجع}} | |||
{{مضادات الهيستامين}} | {{مضادات الهيستامين}} | ||
المراجعة الحالية بتاريخ 07:12، 24 نوفمبر 2013
| 1:1 mixture (racemate) | |
| Systematic (IUPAC) name | |
| (RS)-N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine | |
| Clinical data | |
| AHFS/Drugs.com | monograph |
| MedlinePlus | a682284 |
| Pregnancy cat. | C (AU) C (US) |
| Legal status | ℞-only (US) (injection POM(UK)) |
| Routes | Oral, rectal, IV, IM, topical |
| Pharmacokinetic data | |
| Bioavailability | 88% absorbed but after first-pass metabolism reduced to 25% absolute bioavailability[1] |
| Protein binding | 93% |
| Metabolism | Hepatic glucuronidation and sulfoxidation |
| Half-life | 16-19 hours[1][2] |
| Excretion | Renal and biliary |
| Identifiers | |
| CAS number | 60-87-7 58-33-3 (hydrochloride) |
| ATC code | D04AA10 R06AD02, R06AD05 |
| PubChem | CID 4927 |
| DrugBank | DB01069 |
| ChemSpider | 4758 |
| UNII | FF28EJQ494 |
| KEGG | D00494 |
| ChEBI | CHEBI:8461 |
| ChEMBL | CHEMBL643 |
| Chemical data | |
| Formula | C17H20N2S |
| Mol. mass | 284.42 g/mol |
| |
| |
| | |

بروميتازين (Promethazine)
الزمرة الدوائية
الاستطباب
المعالجة العرضية لحالات التحسس (الشرى، التهاب الأنف، التهاب الملتحمة، اضطربات الجلد الحاكة).
مضادات الاستطباب
الخدج، حديثو الولادة.
الآثار الجانبية
- نعاس، صداع، قصور نفسي حركي.
- احتباس بول، جفاف فم، تشوش رؤية.
- إمساك.
- اضطرابات معدية معوية.
الجرعة
فموياً
- البالغين: 25 ملغ مساءً، تزاد عند الضرورة إلى 25 ملغ مرتين/يوم أو 10-20 ملغ 2-3 مرات/يوم.
- الأطفال من2-5 سنوات: 5-15 ملغ/يوم كجرعة مفردة أو مقسمة على جرعتين.
- الأطفال من 5-10 سنوات: 10-25 ملغ/يوم كجرعة مفردة أو مقسمة على جرعتين.
الحقن العضلي العميق
- الكبار: 25-50 ملغ.
- الجرعة العظمى: 100 ملغ/يوم.
- الأطفال من 5-10 سنوات: 6.25-12.5 ملغ.
المعالجة الإسعافية ردود الفعل التآقية
- بالحقن الوريدي البطيء 25-50 ملغ بشكل محلول مائي تركيزه 2.5 ملغ/مل.
- الجرعة العظمى: 100 ملغ.
تحذيرات
- الزرق، الصرع.
- احتباس بول، ضخامة الموثة، الانسداد البوابي العفجي.
- الاضطرابات الكبدية.
- الاضطرابات القلبية الوعائية.
- الأطفال (يوصى بعد إعطاء مضادات الهيستامين الفينوتيازينية للأطفال دون السنتين).
- المسنون، الحمل، الإرضاع.
- تجنب قيادة السيارات أو تشغيل الآليات.
- تجنب تناول الكحول.
- لا يجوز إعطاؤه عن طريق الحقن تحت الجلد.
- يؤدي أحياناً إلى الحصول على نتائج إيجابية أو سلبية كاذبة في بعض اختبارات الحمل.
مصادر
- ↑ 1٫0 1٫1 Strenkoski-Nix LC, Ermer J, DeCleene S, Cevallos W, Mayer PR (2000). "Pharmacokinetics of promethazine hydrochloride after administration of rectal suppositories and oral syrup to healthy subjects". American Journal of Health-system Pharmacy : AJHP : Official Journal of the American Society of Health-System Pharmacists. 57 (16): 1499–505. PMID 10965395. Unknown parameter
|month=ignored (|date=suggested) (help) - ↑ Paton DM, Webster DR (1985). "Clinical pharmacokinetics of H1-receptor antagonists (the antihistamines)". Clinical Pharmacokinetics. 10 (6): 477–97. PMID 2866055. doi:10.2165/00003088-198510060-00002.