
من موسوعة العلوم العربية
(بالتحويل من Osthol)
اذهب إلى التنقل اذهب إلى البحث
تسمية أيوپاك IUPAC 7-methoxy-8-(3-methylbut-2-enyl)-2-chromenone
رقم CAS 484-12-8
PubChem 10228
ChemSpider 9811 YesY
KEGG C09280

InChI InChI=1S/C15H16O3/c1-10(2)4-7-12-13(17-3)8-5-11-6-9-14(16)18-15(11)12/h4-6,8-9H,7H2,1-3H3
Molecular formula C15H16O3
Molar mass 244.28574
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

اوسثول هو حاصر لقنوات الكالسيوم يوجد في نباتات مثل Cnidium monnieri, Angelica archangelica و Angelica pubescens.

