غوانوكزابينز

من موسوعة العلوم العربية
(بالتحويل من Guanoxabenz)
اذهب إلى: تصفح، ابحث
غوانوكزابينز
Guanoxabenz.png
تسمية أيوپاك IUPAC 2-{[(2,6-dichlorophenyl)methylidene]amino}-1-hydroxyguanidine
المعرفات
رقم CAS 24047-25-4
PubChem 9567831
ChemSpider 7842543 YesY
KEGG D04398
MeSH Guanoxabenz
ChEMBL CHEMBL461343 YesY
كود ATC C02CC07
SMILES

InChI InChI=1S/C8H8Cl2N4O/c9-6-2-1-3-7(10)5(6)4-12-13-8(11)14-15/h1-4,15H,(H3,11,13,14)/b12-4+
الخصائص
Molecular formula C8H8Cl2N4O
Molar mass 247.08 g/mol
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)</small>

غوانوكزابينز (Guanoxabenz) هو المستقلب من الغوانابينز.