الفرق بين المراجعتين ل"نيلتنيكسين"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب'{{Drugbox | Watchedfields = changed | verifiedrevid = 444135566 | IUPAC_name = ''N''-(2,4-dibromo-6-{[(4-hydroxycyclohexyl)amino]methyl}phenyl)thiophene-2-carboxamide |...')
 
(أنشأ الصفحة ب'{{Drugbox | Watchedfields = changed | verifiedrevid = 444135566 | IUPAC_name = ''N''-(2,4-dibromo-6-{[(4-hydroxycyclohexyl)amino]methyl}phenyl)thiophene-2-carboxamide |...')
 
(لا فرق)

المراجعة الحالية بتاريخ 16:12، 29 ديسمبر 2015

{{Drugbox | Watchedfields = changed | verifiedrevid = 444135566 | IUPAC_name = N-(2,4-dibromo-6-{[(4-hydroxycyclohexyl)amino]methyl}phenyl)thiophene-2-carboxamide | image = Neltenexine.png

| tradename = Alveoten | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 99453-84-6 | ATC_prefix = R05 | ATC_suffix = CB14 | PubChem = 3047787 | DrugBank_Ref =  قالب:علامة اختيار | DrugBank = | ChemSpiderID_Ref =  YesY | ChemSpiderID = 16736685 | UNII_Ref =  YesY | UNII = U942DGM90X | KEGG_Ref =  YesY | KEGG = D07382

| C=18 | H=20 | Br=2 | N=2 | O=2 | S=1 | molecular_weight = 488.238 g/mol | smiles = O=C(Nc2c(CN[C@@H]1CC[C@@H](O)CC1)cc(Br)cc2Br)c3cccs3 | InChI = 1/C18H20Br2N2O2S/c19-12-8-11(10-21-13-3-5-14(23)6-4-13)17(15(20)9-12)22-18(24)16-2-1-7-25-16/h1-2,7-9,13-14,21,23H,3-6,10H2,(H,22,24)/t13-,14- | InChIKey = SSLHKNBKUBAHJY-HDJSIYSDBH | StdInChI_Ref =  YesY | StdInChI = 1S/C18H20Br2N2O2S/c19-12-8-11(10-21-13-3-5-14(23)6-4-13)17(15(20)9-12)22-18(24)16-2-1-7-25-16/h1-2,7-9,13-14,21,23H,3-6,10H2,(H,22,24)/t13-,14- | StdInChIKey_Ref =  YesY | StdInChIKey = SSLHKNBKUBAHJY-HDJSIYSDSA-N }}

نيلتنيكسين Neltenexine حال للبلغم.