الفرق بين المراجعتين لصفحة: «تيوبرونين»

مراجعة 08:25، 11 يناير 2016

الاستخدام

يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين disease cystinuria

يمكن استخدامه أيضاً في داء ويلسون (زيادة النحاس في الجسم)، وكذلك لعلاج التهاب المفاصل.

الآثار الجانبية

تشبه الآثار الجانبية المرافقة البنسيلامين D وغيره من المركبات التي تحوي على مجموعات السلفاهدريل النشطة.

المصادر

https://en.wikipedia.org/wiki/Tiopronin

@@ سطر 1: / سطر 1: @@
-{{chembox
+==الاستخدام==
-| Watchedfields = changed
+يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين   disease cystinuria
-| verifiedrevid = 470610633
-| ImageFile = Tiopronin.svg
-| ImageFile_Ref = {{chemboximage|correct|??}}
-| ImageName = Skeletal formula of tiopronin
-| IUPACName = 2-(2-sulfanylpropanoylamino)acetic acid
-| OtherNames = 2-mercaptopropionylglycine <br /> Acadione <br /> Thiola
-|Section1={{Chembox Identifiers
-| CASNo = 1953-02-2
-| CASNo_Ref = {{cascite|correct|CAS}}
-| CASNo1 = 29335-92-0
-| CASNo1_Ref = {{cascite|correct|??}}
-| CASNo1_Comment = <small>''R''</small>
-| PubChem = 5483
-| PubChem1 = 208825
-| PubChem1_Comment = <small>''R''</small>
-| PubChem2 = 736152
-| PubChem2_Comment = <small>''S''</small>
-| ChemSpiderID = 5283
-| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
-| ChemSpiderID1 = 180938
-| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
-| ChemSpiderID1_Comment = <small>''R''</small>
-| ChemSpiderID2 = 643292
-| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
-| ChemSpiderID2_Comment = <small>''S''</small>
-| UNII = C5W04GO61S
-| UNII_Ref = {{fdacite|correct|FDA}}
-| EINECS = 217-778-4
-| KEGG = D01430
-| KEGG_Ref = {{keggcite|correct|kegg}}
-| MeSHName = Tiopronin
-| ChEMBL = 1314
-| ChEMBL_Ref = {{ebicite|correct|EBI}}
-| RTECS = MC0596500
-| Beilstein = 1859822
-| SMILES = CC(S)c(:[o]):[nH]Cc(:[o]):[oH]
-| SMILES1 = CC(S)C(=O)NCC(O)=O
-| StdInChI = 1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8)
-| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
-| StdInChIKey = YTGJWQPHMWSCST-UHFFFAOYSA-N
-| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
-}}
-|Section2={{Chembox Properties
-| C=5 | H=9 | N=1 | S=1 | O=3
-| Appearance = White, opaque crystals
-| MeltingPtC = 93 to 98
-| LogP = −0.674
-| pKa = 3.356
-| pKb = 10.641
-}}
-|Section6={{Chembox Pharmacology
-| ATCCode_prefix = R05
-| ATCCode_suffix = CB12
-| ATC_Supplemental = {{aTCvet|G04|BC90}}
-| Legal_US = Rx
-| Pregnancy_US = C
-}}
-|Section7={{Chembox Hazards
-| GHSPictograms = {{gHS exclamation mark}}
-| GHSSignalWord = '''WARNING'''
-| HPhrases = {{h-phrases|302}}
-| EUClass = {{hazchem Xn}}
-| RPhrases = {{r22}}
-| SPhrases = {{s36/37}}
-| LD50 = 1,300 mg kg<sup>−1</sup> <small>(oral, rat)</small>
-}}
+يمكن استخدامه أيضاً في داء ويلسون (زيادة النحاس في الجسم)، وكذلك لعلاج التهاب المفاصل.
+==الآثار الجانبية==
+تشبه الآثار الجانبية المرافقة البنسيلامين D وغيره من المركبات التي تحوي على مجموعات السلفاهدريل النشطة.
 ==المصادر==

الفرق بين المراجعتين لصفحة: «تيوبرونين»

مراجعة 08:25، 11 يناير 2016

الاستخدام

الآثار الجانبية

المصادر

قائمة التصفح

بحث