الفرق بين المراجعتين ل"بيفانتولول"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب''''بيفانتولول:''' حاصر انتقائي لمستقبلات بيتا. ينقص الفعالية المقلدة للودي داخلية المنشأ ولك...')
 
سطر 1: سطر 1:
'''بيفانتولول:''' حاصر انتقائي ل[[مستقبلات بيتا]]. ينقص الفعالية المقلدة للودي داخلية المنشأ ولكن لديه خواص مثبتة للغشاء ضعيفة ولديه أيضاً فعالية موسعة للأوعية. يعطى فموياً كهيدروكلورايد في تدبير [[ارتفاع ضغط الدم]] وال[[ذبحة الصدرية]].
+
{{Drugbox
 +
| English = Bevantolol
 +
| verifiedrevid = 443421622
 +
| IUPAC_name = (''RS'')-[2-(3,4-dimethoxyphenyl)ethyl][2-hydroxy-3-(3-methylphenoxy)propyl]amine
 +
| image = Bevantolol.png
 +
| width = 240px
 +
| imagename = 1 : 1 mixture (racemate)
 +
| drug_name = Bevantolol
 +
 
 +
<!--Clinical data-->
 +
| tradename = 
 +
| Drugs.com = {{drugs.com|international|bevantolol}}
 +
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
 +
| pregnancy_US = <!-- A / B            / C / D / X -->
 +
| pregnancy_category = 
 +
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
 +
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
 +
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
 +
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
 +
| legal_status = Rx-only
 +
| routes_of_administration = Oral
 +
 
 +
<!--Pharmacokinetic data-->
 +
| bioavailability = 
 +
| protein_bound = 
 +
| metabolism = 
 +
| elimination_half-life = 
 +
| excretion = 
 +
 
 +
<!--Identifiers-->
 +
| CASNo_Ref = {{cascite|correct|CAS}}
 +
| CAS_number = 59170-23-9
 +
| ATC_prefix = C07
 +
| ATC_suffix = AB06
 +
| ATC_supplemental = 
 +
| PubChem = 2372
 +
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 +
| DrugBank = DB01295
 +
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 +
| ChemSpiderID = 2282
 +
| UNII_Ref = {{fdacite|correct|FDA}}
 +
| UNII = 34ZXW6ZV21
 +
| ChEBI_Ref = {{ebicite|correct|EBI}}
 +
| ChEBI = 238698
 +
| ChEMBL_Ref = {{ebicite|correct|EBI}}
 +
| ChEMBL = 314010
 +
 
 +
<!--Chemical data-->
 +
| chemical_formula = 
 +
| C=20 | H=27 | N=1 | O=4
 +
| molecular_weight = 345.43 g/mol
 +
| smiles = O(c1ccc(cc1OC)CCNCC(O)COc2cc(ccc2)C)C
 +
| InChI = 1/C20H27NO4/c1-15-5-4-6-18(11-15)25-14-17(22)13-21-10-9-16-7-8-19(23-2)20(12-16)24-3/h4-8,11-12,17,21-22H,9-10,13-14H2,1-3H3
 +
| InChIKey = HXLAFSUPPDYFEO-UHFFFAOYAN
 +
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 +
| StdInChI = 1S/C20H27NO4/c1-15-5-4-6-18(11-15)25-14-17(22)13-21-10-9-16-7-8-19(23-2)20(12-16)24-3/h4-8,11-12,17,21-22H,9-10,13-14H2,1-3H3
 +
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 +
| StdInChIKey = HXLAFSUPPDYFEO-UHFFFAOYSA-N
 +
}}
 +
'''بيفانتولول (Bevantolol)'''
 +
 
 +
حاصر انتقائي ل[[حاجبات بيتا|مستقبلات بيتا]]. ينقص الفعالية المقلدة للودي داخلية المنشأ ولكن لديه خواص مثبتة للغشاء ضعيفة ولديه أيضاً فعالية موسعة للأوعية. يعطى فموياً كهيدروكلورايد في تدبير [[ارتفاع ضغط الدم]] و[[ذبحة صدرية|الذبحة الصدرية]].
 +
 
 
==المصدر:==
 
==المصدر:==
 
Martindale  36 2009
 
Martindale  36 2009
 +
 +
{{حاصرات بيتا}}
 +
[[تصنيف:أدوية]]
 +
[[تصنيف:موسوعة الأدوية]]
 +
[[تصنيف:خافضات ضغط الدم]]
 +
[[تصنيف:حاصرات بيتا]]

مراجعة 10:07، 5 مايو 2013

Bevantolol
Systematic (IUPAC) name
(RS)-[2-(3,4-dimethoxyphenyl)ethyl][2-hydroxy-3-(3-methylphenoxy)propyl]amine
Clinical data
AHFS/Drugs.com International Drug Names
Pregnancy cat. ?
Legal status Prescription only
Routes Oral
Identifiers
CAS number 59170-23-9
ATC code C07AB06
PubChem CID 2372
DrugBank DB01295
ChemSpider 2282 YesY
UNII 34ZXW6ZV21 YesY
ChEBI CHEBI:238698 YesY
ChEMBL CHEMBL314010 YesY
Chemical data
Formula C20H27NO4 
Mol. mass 345.43 g/mol
 YesY (what is this?)  (verify)

بيفانتولول (Bevantolol)

حاصر انتقائي لمستقبلات بيتا. ينقص الفعالية المقلدة للودي داخلية المنشأ ولكن لديه خواص مثبتة للغشاء ضعيفة ولديه أيضاً فعالية موسعة للأوعية. يعطى فموياً كهيدروكلورايد في تدبير ارتفاع ضغط الدم والذبحة الصدرية.

المصدر:

Martindale 36 2009