الفرق بين المراجعتين ل"بنزوئيل بيروكسيد"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب''''البنزوئيل بيروكسيد Benzoyl peroxide‏''' ==الزمرة الدوائية== أدوية حب الشباب. ==الاسم العلمي وفقاً...')
سطر 1: سطر 1:
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477313648
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageFile = Benzoyl-peroxide.svg
| ImageName = Skeletal formula
| ImageFile1 = Benzoyl-peroxide-3D-balls.png
| ImageName1 = Ball-and-stick model
| IUPACName = dibenzoyl peroxide
|  OtherNames = benzoyl peroxide
| Section1 = {{Chembox Identifiers
|  UNII_Ref = {{fdacite|correct|FDA}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200370
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D03093
| InChI=1/C14H10O4/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-10H
| SMILES = c1ccc(cc1)C(=O)OOC(=O)c2ccccc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H10O4/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-10H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| CASNo = 94-36-0
|    CASNo_Ref = {{cascite|correct|CAS}}
|  EC-number = 202-327-6
|  ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6919
|  PubChem = 7187
|  ATCCode_prefix = D10
|  ATCCode_suffix = AE01
|  ATC_Supplemental = {{ATCvet|D11|AX90}}
|  RTECS = DM8575000
| Section2 = {{Chembox Properties
|  C=14|H=10 |O=4
|  Appearance = colourless solid
|  Density = 1.334 g/cm<sup>3</sup>
|  MeltingPt = 103–105 °C decomp.
|  Solubility = poor
| Section5 = {{Chembox Pharmacology
|  AdminRoutes = topical
|  Bioavail =
|  Metabolism =
|  HalfLife =
|  ProteinBound =
|  Excretion =
|  Legal_status =
|  Legal_US = OTC
|  Legal_UK =
|  Legal_AU =
|  Legal_CA =
|  PregCat =
|  PregCat_AU =
|  PregCat_US = C
| Licence_US = Benzoyl+peroxide
| Section7 = {{Chembox Hazards
|  EUIndex = 617-008-00-0
|  EUClass = Explosive ('''E''')<br/>Irritant ('''Xi''')
|  RPhrases = {{R3}}, {{R7}}, {{R36}}, {{R43}}
|  SPhrases = {{S2}}, {{S3/7}}, {{S14}}, {{S36/37/39}}
|  NFPA-H = 3
|  NFPA-F = 1
|  NFPA-R = 3
|  NFPA-O = ox
|  Autoignition = 80 °C
'''البنزوئيل بيروكسيد Benzoyl peroxide‏'''
'''البنزوئيل بيروكسيد Benzoyl peroxide‏'''
سطر 8: سطر 80:
dibenzoyl peroxide
dibenzoyl peroxide
[[ملف:Benzoyl Peroxide new.png|تصغير]]
==الصيغة الكيميائية==
==الصيغة الكيميائية==

المراجعة الحالية بتاريخ 16:15، 4 أغسطس 2013

بنزوئيل بيروكسيد
رقم CAS 94-36-0
بوبكيم (PubChem) 7187
ChemSpider 6919 YesY
EC-number 202-327-6
KEGG D03093
RTECS number DM8575000
كود ATC D10AE01,QD11AX90
Jmol-3D images Image 1
الصيغة الجزيئية C14H10O4
كتلة مولية 242.21 g mol-1
المظهر colourless solid
الكثافة 1.334 g/cm3
نقطة الانصهار

103–105 °C decomp.

قابلية الذوبان في الماء poor
Routes of
Licence data US
Legal status


EU Index 617-008-00-0
EU classification Explosive (E)
Irritant (Xi)
R-phrases R3, R7, R36, R43
S-phrases (S2), S3/7, S14, S36/37/39
NFPA 704
NFPA 704.svg
80 °C
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

البنزوئيل بيروكسيد Benzoyl peroxide‏

الزمرة الدوائية

أدوية حب الشباب.

الاسم العلمي وفقاً لـIUPAC

dibenzoyl peroxide

الصيغة الكيميائية


الكتلة المولية

242.23 g mol−1


  • مركب صلب عديم اللون، انحلاله ضعيف في الماء.
  • كثافته: 1.334 g/cm3
  • نقطة الانصهار : 103–105 °C decomp.


حب الشباب

هو نمط من العلاج يعرف باسم حال للتقرن keratolytic. هذا يعني أنه يعمل على تحطيم الكيراتين البروتين الذي يشكل جزءاً من بينة الجلد. ينقص فوراً من زيتية الجلد، لكنه قد يأخذ 4-6 أسابيع من العلاج قبل أن يظهر الأثر الكامل للأدوية المستخدمة لعلاج حب الشباب.

عند تطبيق البنزويل بيروكسايد على الجلد فإنه يسبب انهيار الطبقة العليا من خلايا الجلد وتساقطها، هذا يساعد على تحطيم البثور السوداء في الوجه أو الرأس (زُؤَان ودُخَيْنَة) ويفتح الغدد الدهنية، كما يساعد على منع تشكيل بثور جديدة.

للبنزويل بيروكسيد تأثير مضاد للجراثيم ويقتل الجراثيم على الجلد مباشرة، كما يخفض من أعدادها بتخفيض إنتاج الزهم (المخزون الغذائي للجراثيم) بواسطة الغدد الزهمية.

طرق الإعطاء



ينتمي لأدوية المجموعة C

الحالة القانونية