انقر على الصورة لتطلع على بعض المساهمين في بناء الموسوعة

الفرق بين المراجعتين لصفحة: «تيوبرونين»

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
لا ملخص تعديل
لا ملخص تعديل
 
سطر 1: سطر 1:
{{chembox
| Watchedfields = changed
| verifiedrevid = 470610633
| ImageFile = Tiopronin.svg
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageName = Skeletal formula of tiopronin
| IUPACName = 2-(2-sulfanylpropanoylamino)acetic acid
| OtherNames = 2-mercaptopropionylglycine <br /> Acadione <br /> Thiola
|Section1={{Chembox Identifiers
| CASNo = 1953-02-2
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 29335-92-0
| CASNo1_Ref = {{cascite|correct|??}}
| CASNo1_Comment = <small>''R''</small>
| PubChem = 5483
| PubChem1 = 208825
| PubChem1_Comment = <small>''R''</small>
| PubChem2 = 736152
| PubChem2_Comment = <small>''S''</small>
| ChemSpiderID = 5283
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1 = 180938
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1_Comment = <small>''R''</small>
| ChemSpiderID2 = 643292
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID2_Comment = <small>''S''</small>
| UNII = C5W04GO61S
| UNII_Ref = {{fdacite|correct|FDA}}
| EINECS = 217-778-4
| KEGG = D01430
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeSHName = Tiopronin
| ChEMBL = 1314
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| RTECS = MC0596500
| Beilstein = 1859822
| SMILES = CC(S)c(:[o]):[nH]Cc(:[o]):[oH]
| SMILES1 = CC(S)C(=O)NCC(O)=O
| StdInChI = 1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8)
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YTGJWQPHMWSCST-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
|Section2={{Chembox Properties
| C=5 | H=9 | N=1 | S=1 | O=3
| Appearance = White, opaque crystals
| MeltingPtC = 93 to 98
| LogP = −0.674
| pKa = 3.356
| pKb = 10.641
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = R05
| ATCCode_suffix = CB12
| ATC_Supplemental = {{aTCvet|G04|BC90}}
| Legal_US = Rx
| Pregnancy_US = C
}}
|Section7={{Chembox Hazards
| GHSPictograms = {{gHS exclamation mark}}
| GHSSignalWord = '''WARNING'''
| HPhrases = {{h-phrases|302}}
| EUClass = {{hazchem Xn}}
| RPhrases = {{r22}}
| SPhrases = {{s36/37}}
| LD50 = 1,300 mg kg<sup>−1</sup> <small>(oral, rat)</small>
}}
|Section8={{Chembox Related
| OtherFunction_label = alkanoic acids
| OtherFunction = {{unbulleted list|[[Acetylcysteine]]|[[Glycylglycine]]|[[Iminodiacetic acid]]|[[Nitrilotriacetic acid]]|[[n-Oxalylglycine|''N''-Oxalylglycine]]|[[Bucillamine]]|[[Oxalyldiaminopropionic acid]]|[[gamma-Glutamylcysteine|''gamma''-Glutamylcysteine]]}}
| OtherCompounds = {{unbulleted list|[[n-Acetylglycinamide|''N''-Acetylglycinamide]]}}
}}
}}
==الاستخدام==
==الاستخدام==
يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين  disease cystinuria
يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين  disease cystinuria

المراجعة الحالية بتاريخ 08:26، 11 يناير 2016

تيوبرونين
{{{Alt}}}
المعرفات
رقم CAS 1953-02-2
بوبكيم (PubChem) 5483
ChemSpider 5283 YesY, 180938 R YesY, 643292 S YesY
UNII C5W04GO61S YesY
EC number 217-778-4
KEGG D01430
MeSH Tiopronin
ChEMBL CHEMBL1314 YesY
RTECS number MC0596500
Beilstein Reference 1859822
Jmol-3D images Image 1
Image 2
الخصائص
الصيغة الجزيئية C5H9NO3S
كتلة مولية 163.18 g mol-1
المظهر White, opaque crystals
نقطة الانصهار

93 to 98 °C, خطأ في التعبير: كلمة لم نتعرف عليها «to». K, خطأ في التعبير: كلمة لم نتعرف عليها «to». °F

log P −0.674
الحموضة (pKa) 3.356
Basicity (pKb) 10.641
Pharmacology
كود ATC R05CB12
Legal status


-only(US)

المخاطر
GHS pictograms The exclamation-mark pictogram in the Globally Harmonized System of Classification and Labelling of Chemicals (GHS)
GHS signal word WARNING
GHS hazard statements H302
EU classification Harmful Xn
R-phrases R22
S-phrases S36/37
LD50 1,300 mg kg−1 (oral, rat)
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)


الاستخدام

يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين disease cystinuria

يمكن استخدامه أيضاً في داء ويلسون (زيادة النحاس في الجسم)، وكذلك لعلاج التهاب المفاصل.

الآثار الجانبية

تشبه الآثار الجانبية المرافقة البنسيلامين D وغيره من المركبات التي تحوي على مجموعات السلفاهدريل النشطة.

المصادر

https://en.wikipedia.org/wiki/Tiopronin