|
|
| سطر 1: |
سطر 1: |
| {{chembox
| | ==الاستخدام== |
| | Watchedfields = changed
| | يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين disease cystinuria |
| | verifiedrevid = 470610633
| |
| | ImageFile = Tiopronin.svg
| |
| | ImageFile_Ref = {{chemboximage|correct|??}}
| |
| | ImageName = Skeletal formula of tiopronin
| |
| | IUPACName = 2-(2-sulfanylpropanoylamino)acetic acid
| |
| | OtherNames = 2-mercaptopropionylglycine <br /> Acadione <br /> Thiola
| |
| |Section1={{Chembox Identifiers
| |
| | CASNo = 1953-02-2
| |
| | CASNo_Ref = {{cascite|correct|CAS}}
| |
| | CASNo1 = 29335-92-0
| |
| | CASNo1_Ref = {{cascite|correct|??}}
| |
| | CASNo1_Comment = <small>''R''</small>
| |
| | PubChem = 5483
| |
| | PubChem1 = 208825
| |
| | PubChem1_Comment = <small>''R''</small>
| |
| | PubChem2 = 736152
| |
| | PubChem2_Comment = <small>''S''</small>
| |
| | ChemSpiderID = 5283
| |
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| |
| | ChemSpiderID1 = 180938
| |
| | ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| |
| | ChemSpiderID1_Comment = <small>''R''</small>
| |
| | ChemSpiderID2 = 643292
| |
| | ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
| |
| | ChemSpiderID2_Comment = <small>''S''</small>
| |
| | UNII = C5W04GO61S
| |
| | UNII_Ref = {{fdacite|correct|FDA}}
| |
| | EINECS = 217-778-4
| |
| | KEGG = D01430
| |
| | KEGG_Ref = {{keggcite|correct|kegg}}
| |
| | MeSHName = Tiopronin
| |
| | ChEMBL = 1314
| |
| | ChEMBL_Ref = {{ebicite|correct|EBI}}
| |
| | RTECS = MC0596500
| |
| | Beilstein = 1859822
| |
| | SMILES = CC(S)c(:[o]):[nH]Cc(:[o]):[oH]
| |
| | SMILES1 = CC(S)C(=O)NCC(O)=O
| |
| | StdInChI = 1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8)
| |
| | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChIKey = YTGJWQPHMWSCST-UHFFFAOYSA-N
| |
| | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| |
| }}
| |
| |Section2={{Chembox Properties
| |
| | C=5 | H=9 | N=1 | S=1 | O=3
| |
| | Appearance = White, opaque crystals
| |
| | MeltingPtC = 93 to 98
| |
| | LogP = −0.674
| |
| | pKa = 3.356
| |
| | pKb = 10.641
| |
| }}
| |
| |Section6={{Chembox Pharmacology
| |
| | ATCCode_prefix = R05
| |
| | ATCCode_suffix = CB12
| |
| | ATC_Supplemental = {{aTCvet|G04|BC90}}
| |
| | Legal_US = Rx
| |
| | Pregnancy_US = C
| |
| }}
| |
| |Section7={{Chembox Hazards
| |
| | GHSPictograms = {{gHS exclamation mark}}
| |
| | GHSSignalWord = '''WARNING'''
| |
| | HPhrases = {{h-phrases|302}}
| |
| | EUClass = {{hazchem Xn}}
| |
| | RPhrases = {{r22}}
| |
| | SPhrases = {{s36/37}}
| |
| | LD50 = 1,300 mg kg<sup>−1</sup> <small>(oral, rat)</small>
| |
| }}
| |
|
| |
|
| | يمكن استخدامه أيضاً في داء ويلسون (زيادة النحاس في الجسم)، وكذلك لعلاج التهاب المفاصل. |
|
| |
|
| | ==الآثار الجانبية== |
| | |
| | تشبه الآثار الجانبية المرافقة البنسيلامين D وغيره من المركبات التي تحوي على مجموعات السلفاهدريل النشطة. |
|
| |
|
| ==المصادر== | | ==المصادر== |