تيوبرونين: الفرق بين النسختين
اذهب إلى التنقل
اذهب إلى البحث
كنان الطرح (نقاش | مساهمات) لا ملخص تعديل |
كنان الطرح (نقاش | مساهمات) لا ملخص تعديل |
||
| سطر 1: | سطر 1: | ||
{{chembox | |||
| Watchedfields = changed | |||
| verifiedrevid = 470610633 | |||
| ImageFile = Tiopronin.svg | |||
| ImageFile_Ref = {{chemboximage|correct|??}} | |||
| ImageName = Skeletal formula of tiopronin | |||
| IUPACName = 2-(2-sulfanylpropanoylamino)acetic acid | |||
| OtherNames = 2-mercaptopropionylglycine <br /> Acadione <br /> Thiola | |||
|Section1={{Chembox Identifiers | |||
| CASNo = 1953-02-2 | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CASNo1 = 29335-92-0 | |||
| CASNo1_Ref = {{cascite|correct|??}} | |||
| CASNo1_Comment = <small>''R''</small> | |||
| PubChem = 5483 | |||
| PubChem1 = 208825 | |||
| PubChem1_Comment = <small>''R''</small> | |||
| PubChem2 = 736152 | |||
| PubChem2_Comment = <small>''S''</small> | |||
| ChemSpiderID = 5283 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID1 = 180938 | |||
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID1_Comment = <small>''R''</small> | |||
| ChemSpiderID2 = 643292 | |||
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID2_Comment = <small>''S''</small> | |||
| UNII = C5W04GO61S | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| EINECS = 217-778-4 | |||
| KEGG = D01430 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| MeSHName = Tiopronin | |||
| ChEMBL = 1314 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| RTECS = MC0596500 | |||
| Beilstein = 1859822 | |||
| SMILES = CC(S)c(:[o]):[nH]Cc(:[o]):[oH] | |||
| SMILES1 = CC(S)C(=O)NCC(O)=O | |||
| StdInChI = 1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8) | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = YTGJWQPHMWSCST-UHFFFAOYSA-N | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
}} | |||
|Section2={{Chembox Properties | |||
| C=5 | H=9 | N=1 | S=1 | O=3 | |||
| Appearance = White, opaque crystals | |||
| MeltingPtC = 93 to 98 | |||
| LogP = −0.674 | |||
| pKa = 3.356 | |||
| pKb = 10.641 | |||
}} | |||
|Section6={{Chembox Pharmacology | |||
| ATCCode_prefix = R05 | |||
| ATCCode_suffix = CB12 | |||
| ATC_Supplemental = {{aTCvet|G04|BC90}} | |||
| Legal_US = Rx | |||
| Pregnancy_US = C | |||
}} | |||
|Section7={{Chembox Hazards | |||
| GHSPictograms = {{gHS exclamation mark}} | |||
| GHSSignalWord = '''WARNING''' | |||
| HPhrases = {{h-phrases|302}} | |||
| EUClass = {{hazchem Xn}} | |||
| RPhrases = {{r22}} | |||
| SPhrases = {{s36/37}} | |||
| LD50 = 1,300 mg kg<sup>−1</sup> <small>(oral, rat)</small> | |||
}} | |||
|Section8={{Chembox Related | |||
| OtherFunction_label = alkanoic acids | |||
| OtherFunction = {{unbulleted list|[[Acetylcysteine]]|[[Glycylglycine]]|[[Iminodiacetic acid]]|[[Nitrilotriacetic acid]]|[[n-Oxalylglycine|''N''-Oxalylglycine]]|[[Bucillamine]]|[[Oxalyldiaminopropionic acid]]|[[gamma-Glutamylcysteine|''gamma''-Glutamylcysteine]]}} | |||
| OtherCompounds = {{unbulleted list|[[n-Acetylglycinamide|''N''-Acetylglycinamide]]}} | |||
}} | |||
}} | |||
==الاستخدام== | ==الاستخدام== | ||
يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين disease cystinuria | يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين disease cystinuria | ||
المراجعة الحالية بتاريخ 08:26، 11 يناير 2016
| تيوبرونين | |
|---|---|
2-(2-sulfanylpropanoylamino)acetic acid | |
Other names 2-mercaptopropionylglycine | |
| المعرفات | |
| رقم CAS | |
| بوبكيم (PubChem) | |
| ChemSpider | 5283 |
| UNII | C5W04GO61S |
| EC number | 217-778-4 |
| KEGG | D01430 |
| MeSH | |
| ChEMBL | CHEMBL1314 |
| RTECS number | MC0596500 |
| Beilstein Reference | 1859822 |
| Jmol-3D images | Image 1 Image 2 |
| |
| |
| الخصائص | |
| الصيغة الجزيئية | C5H9NO3S |
| كتلة مولية | 163.18 g mol-1 |
| المظهر | White, opaque crystals |
| نقطة الانصهار |
93 to 98 °C, خطأ في التعبير: كلمة لم نتعرف عليها «to». K, خطأ في التعبير: كلمة لم نتعرف عليها «to». °F |
| log P | −0.674 |
| الحموضة (pKa) | 3.356 |
| Basicity (pKb) | 10.641 |
| Pharmacology | |
| كود ATC | R05 |
| Legal status |
|
| المخاطر | |
| GHS pictograms | |
| GHS signal word | WARNING |
| GHS hazard statements | H302 |
| EU classification | |
| R-phrases | R22 |
| S-phrases | S36/37 |
| LD50 | 1,300 mg kg−1 (oral, rat) |
| في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال) | |
الاستخدام
يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين disease cystinuria
يمكن استخدامه أيضاً في داء ويلسون (زيادة النحاس في الجسم)، وكذلك لعلاج التهاب المفاصل.
الآثار الجانبية
تشبه الآثار الجانبية المرافقة البنسيلامين D وغيره من المركبات التي تحوي على مجموعات السلفاهدريل النشطة.
المصادر
https://en.wikipedia.org/wiki/Tiopronin