بيوتروفينون

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث


بيوتروفينون
المعرفات
رقم CAS 495-40-9
PubChem 10315
ChemSpider 9893 YesY
ChEMBL CHEMBL193524 YesY
SMILES

InChI InChI=1S/C10H12O/c1-2-6-10(11)9-7-4-3-5-8-9/h3-5,7-8H,2,6H2,1H3
الخصائص
Molecular formula C10H12O
Molar mass 148.20 g/mol
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

بوتيروفينون Butyrophenone هو مركب كيميائي وتستخدم بعض مشتقاته (وتسمى butyrophenones) عادة لعلاج مختلف الاضطرابات النفسية مثل الفصام، وكذلك بوصفها مضادات القيء.