بينزاميل

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
بينزاميل
Benzamil.png
تسمية أيوپاك IUPAC 3,5-diamino-N-[(1E)- amino(benzylamino)methylidene]- 6-chloropyrazine-2-carboxamide
المعرفات
رقم CAS 2898-76-2
PubChem 108107
ChemSpider 97202 YesY
KEGG C13751
MeSH benzamil
ChEMBL CHEMBL212579 YesY
SMILES

InChI InChI=1S/C13H14ClN7O/c14-9-11(16)20-10(15)8(19-9)12(22)21-13(17)18-6-7-4-2-1-3-5-7/h1-5H,6H2,(H4,15,16,20)(H3,17,18,21,22)
الخصائص
Molecular formula C13H14ClN7O
Molar mass 319.75 g/mol
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

بينزاميل (Benzamil) مدر بول و خافض ضغط.