إلوبروست

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | English = Iloprost | verifiedrevid = 443868674 | IUPAC_name = 5-{(E)-(1S,5S,6R,7R)-7-hydroxy-6[(E)-(3S, 4RS)-3-hydroxy-4-methyl-1-octen-6-inyl]-bi-cyclo[3.3.0]octan-3-ylidene}pentanoic acid | image = iloprost structure.png

| tradename = Ventavis | Drugs.com = monograph | licence_EU = Ventavis (inhalation) or Ilomedine (intravenous) | licence_US = Iloprost | pregnancy_category = C | legal_status = Rx-only | routes_of_administration = Inhaled Intravenous

| bioavailability = The absolute bioavailability of inhaled iloprost has not been determined. | metabolism = Iloprost is metabolized principally via β-oxidation of the carboxyl side chain. The main metabolite is tetranor-iloprost, which is found in the urine in free and conjugated form. In animal experiments, tetranor-iloprost was pharmacologically inactive. | elimination_half-life = 20–30 minutes | excretion = ?

| CASNo_Ref =  YesY | CAS_number = 78919-13-8 | CAS_supplemental = 73873-87-7 | ATC_prefix = B01 | ATC_suffix = AC11 | PubChem = 6435378 | DrugBank_Ref = قالب:Drugbankcite | DrugBank = DB01088 | ChemSpiderID_Ref =  YesY | ChemSpiderID = 4940161 | UNII_Ref =  YesY | UNII = JED5K35YGL | KEGG_Ref =  YesY | KEGG = D02721 | ChEMBL_Ref =  YesY | ChEMBL = 236025

| C=22 | H=32 | O=4 | molecular_weight = 360.48 g/mol | smiles = O=C(O)CCC/C=C1/C[C@@H]2C(/C=C/[C@@H](O)C(C)CC#CC)[C@H](O)C[C@@H]2C1 | InChI = 1/C22H32O4/c1-3-4-7-15(2)20(23)11-10-18-19-13-16(8-5-6-9-22(25)26)12-17(19)14-21(18)24/h8,10-11,15,17-21,23-24H,5-7,9,12-14H2,1-2H3,(H,25,26)/b11-10+,16-8+/t15?,17-,18?,19-,20+,21+/m0/s1 | InChIKey = HIFJCPQKFCZDDL-SGSAMSKHBK | StdInChI_Ref =  YesY | StdInChI = 1S/C22H32O4/c1-3-4-7-15(2)20(23)11-10-18-19-13-16(8-5-6-9-22(25)26)12-17(19)14-21(18)24/h8,10-11,15,17-21,23-24H,5-7,9,12-14H2,1-2H3,(H,25,26)/b11-10+,16-8+/t15?,17-,18?,19-,20+,21+/m0/s1 | StdInChIKey_Ref =  YesY | StdInChIKey = HIFJCPQKFCZDDL-SGSAMSKHSA-N }} إيوبروست (Iloprost) تركيبه الكيميائي إلوبروست تروميثامين، موسع وعائي، ويؤثر على تراكم الصفائح الدموية.

الاستطباب

يستخدم لعلاج ارتفاع التوتر الشرياني المتوسط إلى الشديد البدئي أو الثانوي.

الجرعة

البالغين: يعطى تسريباً وريدياً بمعدل 0.5-2 نانو غرام/كلغ/دقيقة لمدة 6 ساعات يومياً.

يُحضر على شكل محلول معد للتسريب الوريدي بتركيز 67 مكغ/0.5مل.