الفرق بين المراجعتين ل"ميسولفين"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب''''ميسولفين Mesulfen''' هو مشتق دي ميثيل لل thianthrene. تصغير|يسار ==الصيغة الكيميائية==...')
 
سطر 1: سطر 1:
 +
{{Drugbox
 +
| verifiedrevid = 451219049
 +
| IUPAC_name = 2,8-dimethylthianthrene
 +
| image = Mesulfen.png
 +
 +
<!--Clinical data-->
 +
| tradename = 
 +
| Drugs.com = {{drugs.com|international|mesulfen}}
 +
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
 +
| pregnancy_US = <!-- A / B            / C / D / X -->
 +
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
 +
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
 +
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
 +
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
 +
 +
<!--Identifiers-->
 +
| CAS_number_Ref = {{cascite|correct|??}}
 +
| CAS_number = 135-58-0
 +
| ATC_prefix = D10
 +
| ATC_suffix = AB05
 +
| ATC_supplemental =  {{ATC|P03|AA03}} {{ATCvet|P53|AA01}}
 +
| PubChem = 67272
 +
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 +
| UNII_Ref = {{fdacite|correct|FDA}}
 +
| UNII = EG6V6W7WDD
 +
| KEGG_Ref = {{keggcite|correct|kegg}}
 +
| KEGG = D07212
 +
 +
<!--Chemical data-->
 +
| C=14 | H=12 | S=2
 +
| molecular_weight = 244.37508 g/mol
 +
| smiles = CC1=CC2=C(C=C1)SC3=C(S2)C=C(C=C3)C
 +
}}
 
'''ميسولفين Mesulfen''' هو مشتق دي ميثيل لل thianthrene.
 
'''ميسولفين Mesulfen''' هو مشتق دي ميثيل لل thianthrene.
  
[[ملف:220px-Mesulfen.png|تصغير|يسار]]
 
  
 
==الصيغة الكيميائية==
 
==الصيغة الكيميائية==

مراجعة 23:38، 4 أغسطس 2013

ميسولفين
Systematic (IUPAC) name
2,8-dimethylthianthrene
Clinical data
AHFS/Drugs.com International Drug Names
Pregnancy cat. ?
Legal status ?
Identifiers
CAS number 135-58-0 YesY
ATC code D10AB05 P03AA03 QP53AA01
PubChem CID 67272
UNII EG6V6W7WDD YesY
KEGG D07212 YesY
Chemical data
Formula C14H12S2 
Mol. mass 244.37508 g/mol
 YesY (what is this?)  (verify)

ميسولفين Mesulfen هو مشتق دي ميثيل لل thianthrene.


الصيغة الكيميائية

C14-H12-S2

الوزن االجزيئي

244

التصنيف العلاجي

  • عامل مضاد لحب الشباب للتطبيق الموضعي.
  • عامل مضاد للالتهاب.
  • عامل مضاد للحمى.
  • مكافحة الجرب.