الفرق بين المراجعتين ل"تيوكزولون"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب''''تيوكولون Tioxolone'''هو مضاد لحب الشباب. تصغير|يسار ==الصيغة الكيميائية== C7H4O3...')
 
سطر 1: سطر 1:
 +
{{chembox
 +
| Verifiedfields = changed
 +
| Watchedfields = changed
 +
| UNII_Ref = {{fdacite|changed|FDA}}
 +
| UNII = S0FAJ1R9CD
 +
| verifiedrevid = 408937066
 +
|ImageFile=Tioxolone.png
 +
|ImageSize=200px
 +
|IUPACName=6-hydroxy-1,3-benzoxathiol-2-one
 +
|OtherNames=
 +
|Section1={{Chembox Identifiers
 +
| CASNo_Ref = {{cascite|changed|??}}
 +
| CASNo=4991-65-5
 +
| PubChem=72139
 +
| KEGG_Ref = {{keggcite|correct|kegg}}
 +
| KEGG = D07211
 +
| ChEMBL_Ref = {{ebicite|changed|EBI}}
 +
| ChEMBL = 442687
 +
| SMILES=C1=CC2=C(C=C1O)OC(=O)S2
 +
| EINECS = 225-653-0
 +
| ATCCode_prefix = D10
 +
| ATCCode_suffix = AB03
 +
| RTECS = DM2953750
 +
  }}
 +
|Section2={{Chembox Properties
 +
|  Formula=C<sub>7</sub>H<sub>4</sub>O<sub>3</sub>S
 +
|  MolarMass=168.16986
 +
|  Appearance=
 +
|  Density=
 +
|  MeltingPt= 158–160&nbsp;°C
 +
|  BoilingPt=
 +
|  Solubility=
 +
  }}
 +
|Section3={{Chembox Hazards
 +
|  MainHazards=
 +
|  FlashPt=
 +
|  Autoignition=
 +
|  RPhrases = {{R22}}, {{R36/37/38}}
 +
|  SPhrases = {{S26}}
 +
  }}
 +
}}
 
'''تيوكولون Tioxolone'''هو مضاد ل[[حب الشباب]].
 
'''تيوكولون Tioxolone'''هو مضاد ل[[حب الشباب]].
  
[[ملف:200px-Tioxolone.png|تصغير|يسار]]
 
  
 
==الصيغة الكيميائية==
 
==الصيغة الكيميائية==

مراجعة 23:40، 4 أغسطس 2013

تيوكزولون
{{{Alt}}}
المعرفات
رقم CAS 4991-65-5
بوبكيم (PubChem) 72139
EC number 225-653-0
KEGG D07211
ChEMBL CHEMBL442687 N
RTECS number DM2953750
كود ATC D10AB03
Jmol-3D images Image 1
الخصائص
صيغة جزيئية C7H4O3S
الكتلة المولية 168.16986
نقطة الانصهار

158–160 °C

المخاطر
R-phrases R22, R36/37/38
S-phrases S26
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

تيوكولون Tioxoloneهو مضاد لحب الشباب.


الصيغة الكيميائية

C7H4O3S