الفرق بين المراجعتين ل"تراندولابريل"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب'{{Drugbox |English = Trandolapril | verifiedrevid = 470612121 | IUPAC_name = (2''S'',3''aR'',7''aS'')-1-[(2''S'')-2-{[(2''S'')-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}pr...')
 
(أنشأ الصفحة ب'{{Drugbox |English = Trandolapril | verifiedrevid = 470612121 | IUPAC_name = (2''S'',3''aR'',7''aS'')-1-[(2''S'')-2-{[(2''S'')-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}pr...')
 
(لا فرق)

المراجعة الحالية بتاريخ 15:21، 9 مايو 2013

{{Drugbox |English = Trandolapril | verifiedrevid = 470612121 | IUPAC_name = (2S,3aR,7aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]-octahydro-1H-indole-2-carboxylic acid | image = Trandolapril.svg | width2 = 150

| tradename = Mavik | Drugs.com = monograph | MedlinePlus = a697010 | pregnancy_US = D | legal_status = Rx-only | routes_of_administration = Oral

| bioavailability = | protein_bound = Trandolapril 80%
(independent of concentration)
Trandolaprilat 65 to 94%
(concentration-dependent) | metabolism = Hepatic | elimination_half-life = 6 hours (trandolapril)
10 hours (trandolaprilat) | excretion = Fecal and renal

| CASNo_Ref =  YesY | CAS_number_Ref =  YesY | CAS_number = 87679-37-6 | ATC_prefix = C09 | ATC_suffix = AA10 | PubChem = 5484727 | DrugBank_Ref =  قالب:علامة اختيار

| DrugBank = DB00519

| ChemSpiderID_Ref =  YesY | ChemSpiderID = 4588590 | UNII_Ref =  YesY | UNII = 1T0N3G9CRC | KEGG_Ref =  YesY | KEGG = D00383 | ChEMBL_Ref =  YesY | ChEMBL = 1519

| C=24 | H=34 | N=2 | O=5 | molecular_weight = 430.537 g/mol | smiles = O=C(OCC)[C@@H](N[C@H](C(=O)N1[C@H](C(=O)O)C[C@H]2CCCC[C@H]12)C)CCc3ccccc3 | InChI = 1/C24H34N2O5/c1-3-31-24(30)19(14-13-17-9-5-4-6-10-17)25-16(2)22(27)26-20-12-8-7-11-18(20)15-21(26)23(28)29/h4-6,9-10,16,18-21,25H,3,7-8,11-15H2,1-2H3,(H,28,29)/t16-,18+,19-,20-,21-/m0/s1 | InChIKey = VXFJYXUZANRPDJ-WTNASJBWBX | StdInChI_Ref =  YesY | StdInChI = 1S/C24H34N2O5/c1-3-31-24(30)19(14-13-17-9-5-4-6-10-17)25-16(2)22(27)26-20-12-8-7-11-18(20)15-21(26)23(28)29/h4-6,9-10,16,18-21,25H,3,7-8,11-15H2,1-2H3,(H,28,29)/t16-,18+,19-,20-,21-/m0/s1 | StdInChIKey_Ref =  YesY | StdInChIKey = VXFJYXUZANRPDJ-WTNASJBWSA-N }} تراندولابريل (Trandolapril) خافض ضغط مثبط أنزيم ACE المحول للأنجيوتنسين.

الاستطباب

آلية التأثير

يعمل عن طريق تثبيط تنافسي للإنزيم المحول للأنجيوتنسين (ACE)، وهو إنزيم أساسي في نظام الرينين أنجيوتنسين، يلعب دورا هاما في تنظيم ضغط الدم.

الآثار الجانبية

غثيان، إقياء، إسهال، صداع، سعال جاف، دوخة أو الدوار عند الجلوس أو الوقوف، نقص ضغط الدم أو التعب.

الجرعة

  • الجرعة الموصى بها بدءً لعلاج ارتفاع ضغط الدم في المرضى الذين لا يستخدمون مدر للبول: 1 ملغ مرة واحدة/يوم، ويمكن زيادة الجرعات على فترات أسبوعية.
  • معظم المرضى يحتاجون إلى 2-4 ملغ يوميا، وليس هناك فائدة إضافية من جرعات أكبر من 8 ملغ يومياً.
  • ينبغي على المرضى الذين ييستخدمون مدر للبول تبدأ عند 0.5 ملغ/يوم إذا لم يُمكن إيقاف مدر البول قبل 2 إلى 3 أيام من بدء المعالجى بالتراندولابريل.
  • لفشل القلب الجرعة البدئية 1 ملغ مرة واحدة/يوم.
  • ينبغي زيادة الجرعة إلى 4 ملغ مرة واحدة/يوم أو أكبر جرعة تحمل للدواء.

الاحتياطات وموانع الاستعمال

موانع الاستعمال والاحتياطات

الحمل

  • يمكن أن يسبب هذا الدواء تشوهات خلقية وقد يؤدي إلى موت الجنين.
  • أكبر خطر على الجنين خلال الثلث الثاني والثالث من الحمل.
  • يجب إيقاف المعالجة فوراً عند الحمل.

الإرضاع

لا ينبغي إعطائه للأمهات المرضعات.

التداخلات الدوائية

  • على الرغم من أن الجمع بين مثبطات ACE ومدرات البول هو مفيد عموماً، لكن يمكن أن يمكن أن تتفاعل مثبطات ACE الأخرى مع مدرات البول مما قد يتسبب في انخفاض مفرط في ضغط الدم، ويسبب أعراض ضعف، دوخة، ودوار. هذا أكثر احتمالاً في الحدوث عندما يتم أخذ مثبطات ACE مع مدرات البول.
  • عند جمع التراندولابريل مع مكملات البوتاسيوم، والبوتاسيوم التي تحتوي على بدائل ملحية، أو المدرات الحافظة للبوتاسيوم مثل الأميلوريد، سبيرونولاكتون(Aldactone)، وتريامتيرين، قد تؤدي إلى ارتفاع خطير في مستويات بوتاسيوم الدم.

من المستحسن ألا يؤخذ التراندولابريل في نفس الوقت مع الألمنيوم أو مضادات الحموضة المعتمدة على المغنيزيوم، مثل ميلانتا أو مالوكس، مضادات الحموضة هذه ترتبط مع التراندولابريل في الأمعاء وتقلل امتصاصه في الجسم. لذلك يجب تناول جرعات مضادات الحموضة قبل ساعتين على الأقل من أخذ التراندولابريل.

الحفظ والتخزين

يجب تخزين أقراص الدواء في درجة حرارة الغرفة، 15-30 مئوية (59-86 فهرنهايت).

المصادر

https://en.wikipedia.org/wiki/Trandolapril

http://www.medicinenet.com/trandolapril/article.htm