الفرق بين المراجعتين ل"إيزيتيميب"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(مصادر وصفحات عربية)
 
سطر 1: سطر 1:
[[ملف:Ezetimibe.png ‏ ‏‏‏|thumb|250px]]
+
{{Drugbox
 +
| English = Bosentan
 +
| Watchedfields = changed
 +
| verifiedrevid = 461098524
 +
| IUPAC_name = (3''R'',4''S'')-1-(4-fluorophenyl)-3-[(3''S'')-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)azetidin-2-one
 +
| image = Ezetimibe.svg
 +
| width = 200
 +
 
 +
<!--Clinical data-->
 +
| tradename = Zetia
 +
| Drugs.com = {{drugs.com|monograph|ezetimibe}}
 +
| MedlinePlus = a603015
 +
| pregnancy_category = C <small>([[Australia|Au]])</small>, C <small>([[United States|U.S.]])</small>
 +
| legal_status = S4 <small>(Au)</small>, POM <small>([[United Kingdom|UK]])</small>, ℞-only <small>(U.S.)</small>
 +
| routes_of_administration = Oral
 +
 
 +
<!--Pharmacokinetic data-->
 +
| bioavailability = 35–65%
 +
| protein_bound = >90%
 +
| metabolism = Intestinal wall, hepatic
 +
| elimination_half-life = 19–30 hours
 +
| excretion = Renal 11%, faecal 78%
 +
 
 +
<!--Identifiers-->
 +
| CASNo_Ref = {{cascite|correct|CAS}}
 +
| CAS_number_Ref = {{cascite|correct|??}}
 +
| CAS_number = 163222-33-1
 +
| ATC_prefix = C10
 +
| ATC_suffix = AX09
 +
| PubChem = 150311
 +
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 +
| DrugBank = DB00973
 +
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 +
| ChemSpiderID = 132493
 +
| UNII_Ref = {{fdacite|correct|FDA}}
 +
| UNII = EOR26LQQ24
 +
| KEGG_Ref = {{keggcite|correct|kegg}}
 +
| KEGG = D01966
 +
| ChEBI_Ref = {{ebicite|correct|EBI}}
 +
| ChEBI = 49040
 +
| ChEMBL_Ref = {{ebicite|correct|EBI}}
 +
| ChEMBL = 1138
 +
 
 +
<!--Chemical data-->
 +
| C=24 | H=21 | F=2 | N=1 | O=3
 +
| molecular_weight = 409.4&nbsp;g·mol<sup>−1</sup>
 +
| smiles = Fc1ccc(cc1)[C@@H](O)CC[C@H]4C(=O)N(c2ccc(F)cc2)[C@@H]4c3ccc(O)cc3
 +
| InChI = 1/C24H21F2NO3/c25-17-5-1-15(2-6-17)22(29)14-13-21-23(16-3-11-20(28)12-4-16)27(24(21)30)19-9-7-18(26)8-10-19/h1-12,21-23,28-29H,13-14H2/t21-,22+,23-/m1/s1
 +
| InChIKey = OLNTVTPDXPETLC-XPWALMASBY
 +
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 +
| StdInChI = 1S/C24H21F2NO3/c25-17-5-1-15(2-6-17)22(29)14-13-21-23(16-3-11-20(28)12-4-16)27(24(21)30)19-9-7-18(26)8-10-19/h1-12,21-23,28-29H,13-14H2/t21-,22+,23-/m1/s1
 +
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 +
| StdInChIKey = OLNTVTPDXPETLC-XPWALMASSA-N
 +
| melting_point = 164
 +
| melting_high = 166
 +
}}
 
'''إيزيتيميب (Ezetimibe)'''
 
'''إيزيتيميب (Ezetimibe)'''
  

المراجعة الحالية بتاريخ 04:54، 2 أغسطس 2013

إيزيتيميب
Systematic (IUPAC) name
(3R,4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)azetidin-2-one
Clinical data
Trade names Zetia
AHFS/Drugs.com monograph
MedlinePlus a603015
Pregnancy cat. C (Au), C (U.S.)
Legal status S4 (Au), POM (UK), ℞-only (U.S.)
Routes Oral
Pharmacokinetic data
Bioavailability 35–65%
Protein binding >90%
Metabolism Intestinal wall, hepatic
Half-life 19–30 hours
Excretion Renal 11%, faecal 78%
Identifiers
CAS number 163222-33-1 YesY
ATC code C10AX09
PubChem CID 150311
DrugBank DB00973
ChemSpider 132493 YesY
UNII EOR26LQQ24 YesY
KEGG D01966 YesY
ChEBI CHEBI:49040 YesY
ChEMBL CHEMBL1138 YesY
Chemical data
Formula C24H21F2NO3 
Mol. mass 409.4 g·mol−1
Physical data
Melt. point 164–166 °C (327–331 °F)
 YesY (what is this?)  (verify)

إيزيتيميب (Ezetimibe)

الزمرة الدوائية

منظمات شحوم الدم.

الاستطباب

  • علاج مساعد للحمية الغذائية والستاتين في حالة فرط الكوليسترول الأولي (يحذف الستاتين من النظام العلاج عند تحمله أو عدم ملاءمته) وحالة فرط الكوليسترول الأولي متماثل الزيجية.
  • علاج مساعد للحمية الغذائية في حالة فرط السيتوستيرول في الدم متماثل الزيجية.

مضادات الاستطباب

الإرضاع.

الآثار الجانبية

إسهال، ألم بطني، صداع.

الجرعة

فموياً: 10 ملغ مرة واحدة/يوم.

تحذيرات

  • القصور الكبدي (تجنب الاستعمال في حالات القصور المتوسط إلى الشديد).
  • لا يتصح باستخدامه للأطفال دون الـ 10 سنوات.

مصادر

صفحات عربية