ريتونافير

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | verifiedrevid = 477172835 | IUPAC_name = 1,3-thiazol-5-ylmethyl N-[(2S,3S,5S)-3-hydroxy-5-[(2S)-3-methyl-2-{[methyl({[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl})carbamoyl]amino}butanamido]-1,6-diphenylhexan-2-yl]carbamate | image = Ritonavir.svg | image2 = Ritonavir ball-and-stick.png

| tradename = Norvir | Drugs.com = monograph | MedlinePlus = a696029 | pregnancy_category = B (U.S.) | legal_status = ℞-only (U.S.) | routes_of_administration = oral

| bioavailability = | protein_bound = 98-99% | metabolism = | elimination_half-life = 3-5 hours | excretion = mostly fecal

| CAS_number_Ref =  YesY | CAS_number = 155213-67-5 | ATC_prefix = J05 | ATC_suffix = AE03 | ATC_supplemental = | PubChem = 392622 | DrugBank_Ref =  قالب:علامة اختيار

| DrugBank = DB00503

| ChemSpiderID_Ref =  YesY | ChemSpiderID = 347980 | UNII_Ref =  YesY | UNII = O3J8G9O825 | KEGG_Ref =  YesY | KEGG = D00427 | ChEMBL_Ref =  YesY | ChEMBL = 163 | NIAID_ChemDB = 028478

| C=37 | H=48 | N=6 | O=5 | S=2 | molecular_weight = 720.946 g/mol | smiles = CC(C)c4nc(CN(C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)cs4 | InChI = 1/C37H48N6O5S2/c1-24(2)33(42-36(46)43(5)20-29-22-49-35(40-29)25(3)4)34(45)39-28(16-26-12-8-6-9-13-26)18-32(44)31(17-27-14-10-7-11-15-27)41-37(47)48-21-30-19-38-23-50-30/h6-15,19,22-25,28,31-33,44H,16-18,20-21H2,1-5H3,(H,39,45)(H,41,47)(H,42,46)/t28-,31-,32-,33-/m0/s1 | InChIKey = NCDNCNXCDXHOMX-XGKFQTDJBG | StdInChI_Ref =  YesY | StdInChI = 1S/C37H48N6O5S2/c1-24(2)33(42-36(46)43(5)20-29-22-49-35(40-29)25(3)4)34(45)39-28(16-26-12-8-6-9-13-26)18-32(44)31(17-27-14-10-7-11-15-27)41-37(47)48-21-30-19-38-23-50-30/h6-15,19,22-25,28,31-33,44H,16-18,20-21H2,1-5H3,(H,39,45)(H,41,47)(H,42,46)/t28-,31-,32-,33-/m0/s1 | StdInChIKey_Ref =  YesY | StdInChIKey = NCDNCNXCDXHOMX-XGKFQTDJSA-N }} ريتونافير (بالإنجليزية: Ritonavir) هو دواء مضاد لفيروس نقص المناعة البشرية (HIV) ينتمي إلى عائلة مثبطات البروتياز في الإيدز (الادوية المثبطة لانزيم بروتاز )(Potease). ويتم استعماله تزامنا مع دواءلوبينافير (Lopinavir) .[1]

الأستعمالات

يعمل الريتونافير على مكافحة فيروس نقص المناعة الكتسب )، ويستخدم الدواء للمصابين بمرض الإيدز والبالغين منهم بجرعات تقدر بحوالي 100الى 400 ملغ/ في اليوم تعطى عن طريق الفم على شكل دفعة أو دفعتين كداعم لمثبطات البروتياز الأخرى.[2] ويمكن أن تكون الجرعة الأولى للبالغين بمقدار حوالي 300 ملغ ، ثم تزاد بمقدار 100 ملغ مرتين باليوم كل يومين أو ثلاثة ايام وصولاً إلى جرعة نهائية قصوى مقدرها 600 ملغ عن . أما عند الأطفال ، يعطى هذا الدواء في الجرعة الاولية بمقدار 250 ملغ/م2 عن طريق الفم مرتين باليوم، ثم يتم زيادة الجرعة بحوالي 50 ملغ/م2 مرتين باليوم في كل يومين إلى ثلاثة ايام وصولاً إلى جرعة نهائية مقدرها 400 ملغ .

الية عمل الدواء

الية عمل هذا الدواء تكون في منع انتاج فيروسات جديدة من خلايا T التي اصيبت بالفيروس. [3] والمركبان اللذان يتكون منهما هذا الدواء وظيفتهما هي تثبيط عمل انزيم البروتاز. واضافة إلى ذلك، يقوم الريتنوفير بتثبيط عملية تحليل اللوبينافير في الكبد وهكذا يزيد من زمن فعاليته ومن تاثيره أيضا.[4] كما هو الحال مع الادوية الاخرى المضادة لفيروس الايدز ، من اجل منع تطور انواع فيروسية مقاومة للعلاج ومن اجل تعزيز فاعلية العلاج, يتم اعطاء هذا الدواء مدموجا مع ادوية اخرى مضادة لهذا الفيروس مثل لوبينافير .[5]

أثار جانبية

ان تناول اللوبينافير مع الريتونافير قد يسبب مرض السكري,[6] في حال تناوله لفترة طويلة وبشكل متواصل ، وكذلك قد يؤدي إلى ارتفاع نسبة الدهون في الدم وتغييرات في مخزونات الدهون في الجسم، وقد يضر بمستوى اداء الكبد ويسبب ارتفاع مستويات انزيمات الكبد.[7]

المراجع

  1. James Love (2004-06-03). "How much has the public invested in ritonavir, and how much has Abbott?". Essential Inventions. Retrieved 2008-05-06. .
  2. Ceci Connolly (2004-08-05). "NIH Declines to Enter AIDS Drug Price Battle". Washington Post. Retrieved 2006-01-16. 
  3. Zeldin RK, Petruschke RA (2004). "Pharmacological and therapeutic properties of ritonavir-boosted protease inhibitor therapy in HIV-infected patients". Journal of Antimicrobial Chemotherapy 53 (1): 4–9. PMID 14657084. doi:10.1093/jac/dkh029. 
  4. Ritonavir, Merck Manual
  5. Merry, Concepta; Barry, Michael G.; Mulcahy, Fiona; Ryan, Mairin; Heavey, Jane; Tjia, John F.; Gibbons, Sara E.; Breckenridge, Alasdair M.; Back, David J. (1997). "Saquinavir pharmacokinetics alone and in combination with ritonavir in HIV-infected patients". AIDS 11 (4): F29–F33. PMID 9084785. doi:10.1097/00002030-199704000-00001. 
  6. Norvir, rxlist.com
  7. Bauer J et al. (2004). "Ritonavir: An Extraordinary Example of Conformational Polymorphism". Pharmaceutical Research 18 (6): 859–866. PMID 11474792. doi:10.1023/A:1011052932607. 

وصلات اضافية

قالب:HIVpharm