ترول نترات

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
ترول نترات
رقم CAS 7077-34-1
PubChem 11499
ChemSpider 11015 YesY
كود ATC C01DA09

InChI InChI=1S/C6H12N4O9/c11-8(12)17-4-1-7(2-5-18-9(13)14)3-6-19-10(15)16/h1-6H2
Molecular formula C6H12N4O9
Molar mass 284.18 g/mol
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

ترول نترات Trolnitrate من مشتقات النترات.