إيباسايتابين

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
إيباسايتابين
Ibacitabine.svg
المعرفات
رقم CAS 611-53-0
PubChem 65050
ChemSpider 58561 N
UNII 3EK8532DZV YesY
KEGG D07200
ChEMBL CHEMBL2104340 N
SMILES

InChI InChI=1S/C9H12IN3O4/c10-4-2-13(9(16)12-8(4)11)7-1-5(15)6(3-14)17-7/h2,5-7,14-15H,1,3H2,(H2,11,12,16)/t5-,6+,7+/m0/s1
الخصائص
Molecular formula C9H12IN3O4
Molar mass 353.11375
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

إيباسايتابين Ibacitabine هو مضاد فيروسي.