الفرق بين المراجعتين ل"أولوداتيرول"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب'{{Drugbox | English = Olodaterol | IUPAC_name = 6-hydroxy-8-{(1''R'')-1-hydroxy-2-{[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino}ethyl}-4''H''-1,4-benzoxazin-3-o...')
 
(أنشأ الصفحة ب'{{Drugbox | English = Olodaterol | IUPAC_name = 6-hydroxy-8-{(1''R'')-1-hydroxy-2-{[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino}ethyl}-4''H''-1,4-benzoxazin-3-o...')
 
(لا فرق)

المراجعة الحالية بتاريخ 00:51، 12 يوليو 2013

{{Drugbox | English = Olodaterol | IUPAC_name = 6-hydroxy-8-{(1R)-1-hydroxy-2-{[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino}ethyl}-4H-1,4-benzoxazin-3-one | image = Olodaterol skeletal.svg | alt = | caption =

| tradename = Striverdi | Drugs.com = | MedlinePlus = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Investigational | routes_of_administration = Inhalation

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = | ATCvet = | ATC_prefix = None | ATC_suffix = | UNII = VD2YSN1AFD | PubChem = 11504295 | DrugBank = | ChEMBL = 605846

| C=21 | H=26 | N=2 | O=5 | molecular_weight = 386.44 g/mol | smiles = CC(C)(CC1=CC=C(C=C1)OC)NCC(C2=CC(=CC3=C2OCC(=O)N3)O)O | ChemSpiderID = 9679097 | InChI = 1/C21H26N2O5/c1-21(2,10-13-4-6-15(27-3)7-5-13)22-11-18(25)16-8-14(24)9-17-20(16)28-12-19(26)23-17/h4-9,18,22,24-25H,10-12H2,1-3H3,(H,23,26)/t18-/m0/s1 | InChIKey = COUYJEVMBVSIHV-SFHVURJKBP | StdInChI = 1S/C21H26N2O5/c1-21(2,10-13-4-6-15(27-3)7-5-13)22-11-18(25)16-8-14(24)9-17-20(16)28-12-19(26)23-17/h4-9,18,22,24-25H,10-12H2,1-3H3,(H,23,26)/t18-/m0/s1 | StdInChIKey = COUYJEVMBVSIHV-SFHVURJKSA-N }} أولوداتيرول (Olodaterol) ناهض لمستقبلات بيتا قيد التطوير لعلاج المرضى الذين يعانون من مرض الانسداد الرئوي المزمن (COPD).

ويجري تطوير على أخذها مرة واحدة يوميا لعلاج إعاقة تدفق الهواء في المرضى الذين يعانون من مرض الانسداد الرئوي المزمن بما في ذلك التهاب القصبات المزمن و/أو انتفاخ الرئة.

المصادر

https://en.wikipedia.org/wiki/Olodaterol