9-أمينوسيريدين

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
9-أمينوسيريدين
9-aminoacridine.png
المعرفات
رقم CAS 90-45-9
PubChem 7019
ChemSpider 6752 YesY
UNII 78OY3Z0P7Z YesY
ChEBI CHEBI:74789
ChEMBL CHEMBL43184 YesY
كود ATC D08AA02
SMILES

InChI InChI=1S/C13H10N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H2,14,15)
الخصائص
Molecular formula C13H10N2
Molar mass 194.2319 g/mol
المظهر Crystalline yellow
نقطة الانصهار

300 °C, 573 K, 572 °F

في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

9-أمينوسيريدين 9-Aminoacridine هو صبغة عالية الفلور مستخدمة سريريا كمطهر موضعي وتجريبيا كمادة مطفرة, وكمؤشر للرقم الهيدروجيني pH بين الخلايا.