سينيبازيت

من موسوعة العلوم العربية
مراجعة 12:29، 10 أغسطس 2014 بواسطة سلام المجذوب (نقاش | مساهمات) (أنشأ الصفحة ب'{{Drugbox | IUPAC_name = ethyl 2-{4-[(2''Z'')-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl}acetate | image = Cinepazet.png <!--Clinical data--> | tradename = ...')
(فرق) → مراجعة أقدم | المراجعة الحالية (فرق) | مراجعة أحدث ← (فرق)
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | IUPAC_name = ethyl 2-{4-[(2Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl}acetate | image = Cinepazet.png

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 23887-41-4 | ATC_prefix = C01 | ATC_suffix = DX14 | PubChem = 6436156 | DrugBank = | ChEMBL = 2110784 | ChemSpiderID = 4940822 | UNII_Ref =  YesY | UNII = 0LC95WWE9Q

| C=20 | H=28 | N=2 | O=6 | molecular_weight = 392.45 g/mol | smiles = O=C(OCC)CN2CCN(C(=O)/C=C\c1cc(OC)c(OC)c(OC)c1)CC2 | InChI = 1/C20H28N2O6/c1-5-28-19(24)14-21-8-10-22(11-9-21)18(23)7-6-15-12-16(25-2)20(27-4)17(13-15)26-3/h6-7,12-13H,5,8-11,14H2,1-4H3/b7-6- | InChIKey = XDUOTWNXVDBCDY-SREVYHEPBX | density = 1.172 }}

سينيبازيت Cinepazet هو موسع وعائي.

الاصطناع

يتم اصطناعه على مرحلتين, بدءا من حمض 3،4،5-Trimethoyxcinnamic متفاعلا مع SOCL2 (كلوريد ثيونيل). ثم يتم مفاعلة الناتج 3,4,5-Trimethoxycinnamoyl chloride مع ethyl piperazinoacetate والبيريدين.