أولوداتيرول

من موسوعة العلوم العربية
مراجعة 00:51، 12 يوليو 2013 بواسطة كنان الطرح (نقاش | مساهمات) (أنشأ الصفحة ب'{{Drugbox | English = Olodaterol | IUPAC_name = 6-hydroxy-8-{(1''R'')-1-hydroxy-2-{[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino}ethyl}-4''H''-1,4-benzoxazin-3-o...')
(فرق) → مراجعة أقدم | المراجعة الحالية (فرق) | مراجعة أحدث ← (فرق)
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | English = Olodaterol | IUPAC_name = 6-hydroxy-8-{(1R)-1-hydroxy-2-{[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino}ethyl}-4H-1,4-benzoxazin-3-one | image = Olodaterol skeletal.svg | alt = | caption =

| tradename = Striverdi | Drugs.com = | MedlinePlus = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Investigational | routes_of_administration = Inhalation

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = | ATCvet = | ATC_prefix = None | ATC_suffix = | UNII = VD2YSN1AFD | PubChem = 11504295 | DrugBank = | ChEMBL = 605846

| C=21 | H=26 | N=2 | O=5 | molecular_weight = 386.44 g/mol | smiles = CC(C)(CC1=CC=C(C=C1)OC)NCC(C2=CC(=CC3=C2OCC(=O)N3)O)O | ChemSpiderID = 9679097 | InChI = 1/C21H26N2O5/c1-21(2,10-13-4-6-15(27-3)7-5-13)22-11-18(25)16-8-14(24)9-17-20(16)28-12-19(26)23-17/h4-9,18,22,24-25H,10-12H2,1-3H3,(H,23,26)/t18-/m0/s1 | InChIKey = COUYJEVMBVSIHV-SFHVURJKBP | StdInChI = 1S/C21H26N2O5/c1-21(2,10-13-4-6-15(27-3)7-5-13)22-11-18(25)16-8-14(24)9-17-20(16)28-12-19(26)23-17/h4-9,18,22,24-25H,10-12H2,1-3H3,(H,23,26)/t18-/m0/s1 | StdInChIKey = COUYJEVMBVSIHV-SFHVURJKSA-N }} أولوداتيرول (Olodaterol) ناهض لمستقبلات بيتا قيد التطوير لعلاج المرضى الذين يعانون من مرض الانسداد الرئوي المزمن (COPD).

ويجري تطوير على أخذها مرة واحدة يوميا لعلاج إعاقة تدفق الهواء في المرضى الذين يعانون من مرض الانسداد الرئوي المزمن بما في ذلك التهاب القصبات المزمن و/أو انتفاخ الرئة.

المصادر

https://en.wikipedia.org/wiki/Olodaterol