الفرق بين المراجعتين ل"كابسيسين"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب'{{معلومات كيمياء | Watchedfields = changed | verifiedrevid = 443496864 | صورة1 = kapsaicyna.svg | حجم صورة1 = 250px | صورة2 = Capsaicin-3D-vd...')
 
 
سطر 1: سطر 1:
{{معلومات كيمياء
+
{{chembox
 
| Watchedfields = changed
 
| Watchedfields = changed
 
| verifiedrevid = 443496864
 
| verifiedrevid = 443496864
| صورة1 = kapsaicyna.svg
+
| ImageFile1 = kapsaicyna.svg
| حجم صورة1 = 250px
+
| ImageFile2 = Capsaicin-3D-vdW.png
| صورة2 = Capsaicin-3D-vdW.png
+
| PIN = (6''E'')-''N''-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methylnon-6-enamide
| حجم صورة2 = 250px
+
| OtherNames = (''E'')-''N''-(4-Hydroxy-3-methoxybenzyl)-8-methylnon-6-enamide<br />8-Methyl-''N''-vanillyl-''trans''-6-nonenamide<br>''trans''-8-Methyl-''N''-vanillylnon-6-enamide<br />(''E'')-Capsaicin<br />Capsicine<br />Capsicin<br />CPS
| الاسم النظامي = 8-Methyl-''N''-vanillyl-''trans''-6-nonenamide
+
|Section1={{Chembox Identifiers
| اسماء أخرى = (''E'')-N-(4-Hydroxy-3-methoxybenzyl)<br>-8-methylnon-6-enamide,<br> trans-8-Methyl-''N''-vanillylnon<br>-6-enamide, (''E'')-Capsaicin, Capsicine, Capsicin,<br> CPS, C
+
| IUPHAR_ligand = 2486
| قسم1 = {{معلومات كيمياء -معرفات
+
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
 
 
| UNII = S07O44R1ZM
 
| UNII = S07O44R1ZM
 
| InChI = 1/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+
 
| InChI = 1/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+
سطر 28: سطر 27:
 
| ChEBI = 3374
 
| ChEBI = 3374
 
| SMILES = O=C(NCc1cc(OC)c(O)cc1)CCCC/C=C/C(C)C
 
| SMILES = O=C(NCc1cc(OC)c(O)cc1)CCCC/C=C/C(C)C
| ATCCode_prefix = M02
 
| ATCCode_suffix = AB01
 
| ATC_Supplemental = {{ATC|N01|BX04}}
 
 
| KEGG_Ref = {{keggcite|correct|kegg}}
 
| KEGG_Ref = {{keggcite|correct|kegg}}
 
| KEGG = C06866
 
| KEGG = C06866
 
   }}
 
   }}
| قسم2 = {{معلومات كيمياء - خواص
+
|Section2={{Chembox Properties
| C=18|H=27|N=1|O=3
+
| C=18 | H=27 | N=1 | O=3
| Absorption maxima = 280 nm
+
| LambdaMax = 280 nm
| Appearance = pure dark red solid
+
| Appearance = crystalline white powder<ref>[http://www.chemspider.com/Chemical-Structure.1265957.html ChemSpider – Capsaicin]</ref>
 
| Odor = highly volatile and pungent
 
| Odor = highly volatile and pungent
 +
| VaporPressure = {{val|1.32|e=-8|u=mm Hg}} at {{val|25|u=degC}}<ref name=PubChem>[https://pubchem.ncbi.nlm.nih.gov/compound/Capsaicin#section=Experimental-Properties]</ref>
 
| Density =
 
| Density =
| MeltingPtCL = 62
+
| MeltingPtC = 62 to 65
| MeltingPtCH = 65
+
| BoilingPtC = 210 to 220
| BoilingPtCL = 210
+
| BoilingPt_notes = 0.01 Torr
| BoilingPtCH = 220
+
| Solubility = 0.0013 g/100 mL
| Boiling_notes = 0.01 Torr
+
| SolubleOther = soluble in alcohol, [[ether]], [[benzene]] <br> slightly soluble in [[carbon disulfide|CS<sub>2</sub>]], [[hydrochloric acid|HCl]], [[petroleum]]
| Solubility = .0013 g/100 mL
 
| SolubleOther = soluble in alcohol, [[إيثر]], [[بنزين (مركب كيميائي)]] <br> slightly soluble in [[ثنائي كبريتيد الكربون]]. [[حمض الهيدروكلوريك]], [[نفط]]
 
 
  }}
 
  }}
| قسم3 = {{معلومات كيمياء - بنية
+
|Section3={{Chembox Structure
 
| CrystalStruct = monoclinic
 
| CrystalStruct = monoclinic
 
}}
 
}}
| قسم4 = {{معلومات كيمياء - مخاطر
+
|Section6={{Chembox Pharmacology
| ExternalMSDS = [https://docs.google.com/viewer?a=v&q=cache:0qEFkQwng5sJ:www.sciencelab.com/msds.php?msdsId%3D9923296+capsaiacin+msds&hl=en&gl=us&pid=bl&srcid=ADGEESiVORhJth5_Ji4WTD0mNETNU8rIwY2C3LTNaj9MfdynWiapqmSB8w7p-TfQqYC3--kKvFWW7u9EZ5QOmriEfLKRsWPquEQtjWo1joKGpqhvyfm-XUGbr17v162HlzZSU9SWdKZI&sig=AHIEtbSLvraa7YE_jZ4cDurp9iX-TCGPiA Capsaicin, Natural MSDS]
+
| ATCCode_prefix = M02
 +
| ATCCode_suffix = AB01
 +
| ATC_Supplemental = {{ATC|N01|BX04}}
 +
| Licence_EU=yes
 +
}}
 +
|Section7={{Chembox Hazards
 +
| ExternalSDS = [http://www.sciencelab.com/msds.php?msdsId=9923296 Capsaicin, Natural MSDS]
 
| MainHazards = Toxic ('''T''')
 
| MainHazards = Toxic ('''T''')
 
| RPhrases = {{R24/25}}
 
| RPhrases = {{R24/25}}
 
| SPhrases = {{S26}}, {{S36/37/39}}, {{S45}}
 
| SPhrases = {{S26}}, {{S36/37/39}}, {{S45}}
 
| FlashPt =
 
| FlashPt =
| Autoignition =
+
| AutoignitionPt =
 
| NFPA-H = 2
 
| NFPA-H = 2
 
| NFPA-F = 1
 
| NFPA-F = 1
سطر 63: سطر 64:
 
  }}
 
  }}
 
}}
 
}}
{{pepper
+
{{Infobox pepper
| boxwidth=250px
+
| image = Hottest-chili-rating.gif
| image=
+
| heat = Above Peak
| heat= Above Peak ([[مقياس سكوفيل|SR]]: 15,000,000-16,000,000)
+
| scoville = 15,000,000–16,000,000
 
}}
 
}}
  

المراجعة الحالية بتاريخ 17:02، 19 نوفمبر 2017

كابسيسين
{{{Alt}}}
{{{Alt}}}
المعرفات
رقم CAS 404-86-4
بوبكيم (PubChem) 1548943
ChemSpider 1265957 YesY
UNII S07O44R1ZM YesY
EC number 206-969-8
KEGG C06866
ChEBI CHEBI:3374
ChEMBL CHEMBL294199 YesY
IUPHAR ligand 2486
Jmol-3D images Image 1
الخصائص
الصيغة الجزيئية C18H27NO3
كتلة مولية 305.4 g mol-1
المظهر crystalline white powder[1]
Odor highly volatile and pungent
نقطة الانصهار

62 to 65 °C, خطأ في التعبير: كلمة غير متعرف عليها "to" K, خطأ في التعبير: كلمة غير متعرف عليها "to" °F

نقطة الغليان

210 to 220 °C, خطأ في التعبير: كلمة غير متعرف عليها "to" K, خطأ في التعبير: كلمة غير متعرف عليها "to" °F

قابلية الذوبان في الماء 0.0013 g/100 mL
قابلية الذوبان soluble in alcohol, ether, benzene
slightly soluble in CS2, HCl, petroleum
Vapor pressure 1.32×10−8 قالب:Val/units at 25 قالب:Val/units[2]
λmax 280 nm
Structure
Crystal structure monoclinic
Pharmacology
كود ATC M02AB01
Licence data EU
المخاطر
R-phrases R24/25
S-phrases S26, S36/37/39, S45
Main hazards Toxic (T)
NFPA 704
NFPA 704.svg
1
2
0
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)
كابسيسين
ملف:Hottest-chili-rating.gif
Heat Above Peak
Scoville scale 15,000,000–16,000,000 SHU

كابسيسين (بالإنجليزية: Capsaicin) واسمه العلمي "8-ميثيل-N-فانيلايل-6-نونيناميد" وصيغته الجزيئية هي ((CH3)sub>2CHCH=CH(CH2)sub>4CONHCH2C6H3-4-(OH)-3-(OCH3)) هو المركب النشط في الفلفل الحار. و،. والكابسيسين النقي مادة عديمة اللون والرائحة كما أنه كاره للماء. تتراوح قوة الكابسايسين النقي التي تمنح الفلفل الحار طعمه الحارق بين 15 مليون و16 مليون وحدة سكوفيل.

الإستعمالات

هو مادة مثيرة للثدييات بما فيها البشر

السمية

ينتج شعور بالحرق في أي نسيج يلامسه.

انظر أيضا

مراجع

وصلات خارجية