نتائج البحث

| IUPAC_name = (3''Z'')-3-[1]benzofuro[3,2-''c''][1]benzoxepin-6(12''H'')-ylidene-''N,N''-dimethylpropan-1-amine | C=21 | H=21 | N=1 | O=2

...rough a hemifusion intermediate by sequential activity of glycoproteins D, H, L, and B|author=Subramanian RP, Geraghty RJ|pmid=17299053|journal=Proceedi

| IUPACName = 1-(3''H''-Imidazol-4-yl)propan-2-amine | SystematicName = 1-(1''H''-Imidazol-4-yl)propan-2-amine<ref>https://www.ebi.ac.uk/chebi/searchId.do?

| C=15 | H=13 | N=1 | O=3 ...13NO3/c16-14-11(9-13(17)18)7-4-8-12(14)15(19)10-5-2-1-3-6-10/h1-8H,9,16H2,(H,17,18)

...mine T, Saito S, Kaneko M, Sekiguchi T, Sugimoto H, Takehara K, Takagi H | title = Effect of biotin on ammonia intoxication in rats and mice | journal = J.

...irst3=PB|last4=Kiley|first4=MP|last5=Sanchez|first5=A|coauthors=''et al.''|title=Filoviridae|url=http://www.ncbi.nlm.nih.gov/ICTVdb/Ictv/fs_filov.htm|access

| C=13 | H=20 | N=20 | O=3 | S=1 ...sdate = }}</ref><ref name="pmid3525089">{{cite journal | author = Lant A | title = Diuretic drugs. Progress in clinical pharmacology | journal = Drugs | vol

| title = Handbook of Chemistry and Physics | InChI = 1S/C4H6O6.2Na/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2

...f><ref name="Braun-1992">{{cite journal | author = Braun JE, Severson DL | title = Regulation of the synthesis, processing and translocation of lipoprotein

...ue K, Inazawa J, Nakagawa H, Shimada T, Yamazaki H, Guengerich FP, Abe T | title = Assignment of the human cytochrome P-450 nifedipine oxidase gene (CYP3A4) ...شاطه الى انتاج المواد المسببة لل[[سرطان]]. <ref name="entrez">{{cite web | title = Entrez Gene: cytochrome P450| url = http://www.ncbi.nlm.nih.gov/sites/ent

| elimination_half-life = 2.5 hr<ref>{{cite web | title = Half life | url = http://www.drugbank.ca/drugs/DB04552 | work = Drug Bank ...2/c14-13(15,16)8-3-1-4-9(7-8)18-11-10(12(19)20)5-2-6-17-11/h1-7H,(H,17,18)(H,19,20)

...//www.ebi.ac.uk/chebi/chebiOntology.do?treeView=true&chebiId=CHEBI:74266 | title = N-acylurea | publisher = European Molecular Biology Laboratory}}</ref> ...الريش.<ref>{{cite book | title = Encyclopedia of Insects | editor =Vincent H. Resh and Ring T. Cardé | publisher = Academic Press | date = 2009 | page

...] و10% من [[حمض الخليك]] الجليدي.<ref>{{cite web |accessdate=13 JAN 2009 |title=MSDS :: Carnoy's Solution (Fixative) |url=http://www.sciencestuff.com/msds/ |title=Oral and maxillofacial pathology: a rationale for diagnosis and treatment

| C = 11 | H = 10 | O = 6 ...= 1/C11H10O6/c1-6(12)16-9-5-3-4-8(11(14)15)10(9)17-7(2)13/h3-5H,1-2H3,(H,14,15)

| C=23 | H=26 | N=2 | O=2 ...9-9-5-2-6-10-19)20-12-15-25(16-13-20)17-18-7-3-1-4-8-18/h1-10,20H,11-17H2,(H,24,26,27)/t23-/m1/s1

| C=22 | H=29 | F=3 | O=3 | smiles = CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@@H](C4=CC(=O)CC[C@]34C)C(F)(F)F)C)O

...ut-2-yn-1-yl)-3- methyl-1-[(4-methylquinazolin-2-yl)methyl]-3,7-dihydro-1''H''-purine-2,6-dione | C=25 | H=28 | N=8 | O=2

| Formula = C₁₂H₂₂CuO₁₄<!-- e.g. Na₂CO₃ --> | NFPA-H =

| InChI = 1/Ca.2H2O/h;2*1H2/q+2;;/p-2 | StdInChI = 1S/Ca.2H2O/h;2*1H2/q+2;;/p-2

| C=17 | H=24 | N=2 | O=2 ...)13-12-17(14-8-6-5-7-9-14)11-10-15(20)18-16(17)21/h5-9H,3-4,10-13H2,1-2H3,(H,18,20,21)