الفرق بين المراجعتين لصفحة: «كابسيسين»
(أنشأ الصفحة ب'{{معلومات كيمياء | Watchedfields = changed | verifiedrevid = 443496864 | صورة1 = kapsaicyna.svg | حجم صورة1 = 250px | صورة2 = Capsaicin-3D-vd...') |
لا ملخص تعديل |
||
سطر 1: | سطر 1: | ||
{{ | {{chembox | ||
| Watchedfields = changed | | Watchedfields = changed | ||
| verifiedrevid = 443496864 | | verifiedrevid = 443496864 | ||
| | | ImageFile1 = kapsaicyna.svg | ||
| | | ImageFile2 = Capsaicin-3D-vdW.png | ||
| PIN = (6''E'')-''N''-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methylnon-6-enamide | |||
| | | OtherNames = (''E'')-''N''-(4-Hydroxy-3-methoxybenzyl)-8-methylnon-6-enamide<br />8-Methyl-''N''-vanillyl-''trans''-6-nonenamide<br>''trans''-8-Methyl-''N''-vanillylnon-6-enamide<br />(''E'')-Capsaicin<br />Capsicine<br />Capsicin<br />CPS | ||
|Section1={{Chembox Identifiers | |||
| | | IUPHAR_ligand = 2486 | ||
| | | UNII_Ref = {{fdacite|correct|FDA}} | ||
| | |||
| UNII = S07O44R1ZM | | UNII = S07O44R1ZM | ||
| InChI = 1/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+ | | InChI = 1/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+ | ||
سطر 28: | سطر 27: | ||
| ChEBI = 3374 | | ChEBI = 3374 | ||
| SMILES = O=C(NCc1cc(OC)c(O)cc1)CCCC/C=C/C(C)C | | SMILES = O=C(NCc1cc(OC)c(O)cc1)CCCC/C=C/C(C)C | ||
| KEGG_Ref = {{keggcite|correct|kegg}} | | KEGG_Ref = {{keggcite|correct|kegg}} | ||
| KEGG = C06866 | | KEGG = C06866 | ||
}} | }} | ||
| | |Section2={{Chembox Properties | ||
| C=18|H=27|N=1|O=3 | | C=18 | H=27 | N=1 | O=3 | ||
| | | LambdaMax = 280 nm | ||
| Appearance = | | Appearance = crystalline white powder<ref>[http://www.chemspider.com/Chemical-Structure.1265957.html ChemSpider – Capsaicin]</ref> | ||
| Odor = highly volatile and pungent | | Odor = highly volatile and pungent | ||
| VaporPressure = {{val|1.32|e=-8|u=mm Hg}} at {{val|25|u=degC}}<ref name=PubChem>[https://pubchem.ncbi.nlm.nih.gov/compound/Capsaicin#section=Experimental-Properties]</ref> | |||
| Density = | | Density = | ||
| | | MeltingPtC = 62 to 65 | ||
| BoilingPtC = 210 to 220 | |||
| | | BoilingPt_notes = 0.01 Torr | ||
| Solubility = 0.0013 g/100 mL | |||
| | | SolubleOther = soluble in alcohol, [[ether]], [[benzene]] <br> slightly soluble in [[carbon disulfide|CS<sub>2</sub>]], [[hydrochloric acid|HCl]], [[petroleum]] | ||
| Solubility = .0013 g/100 mL | |||
| SolubleOther = soluble in alcohol, [[ | |||
}} | }} | ||
| | |Section3={{Chembox Structure | ||
| CrystalStruct = monoclinic | | CrystalStruct = monoclinic | ||
}} | }} | ||
| | |Section6={{Chembox Pharmacology | ||
| | | ATCCode_prefix = M02 | ||
| ATCCode_suffix = AB01 | |||
| ATC_Supplemental = {{ATC|N01|BX04}} | |||
| Licence_EU=yes | |||
}} | |||
|Section7={{Chembox Hazards | |||
| ExternalSDS = [http://www.sciencelab.com/msds.php?msdsId=9923296 Capsaicin, Natural MSDS] | |||
| MainHazards = Toxic ('''T''') | | MainHazards = Toxic ('''T''') | ||
| RPhrases = {{R24/25}} | | RPhrases = {{R24/25}} | ||
| SPhrases = {{S26}}, {{S36/37/39}}, {{S45}} | | SPhrases = {{S26}}, {{S36/37/39}}, {{S45}} | ||
| FlashPt = | | FlashPt = | ||
| | | AutoignitionPt = | ||
| NFPA-H = 2 | | NFPA-H = 2 | ||
| NFPA-F = 1 | | NFPA-F = 1 | ||
سطر 63: | سطر 64: | ||
}} | }} | ||
}} | }} | ||
{{pepper | {{Infobox pepper | ||
| image = Hottest-chili-rating.gif | |||
| image= | | heat = Above Peak | ||
| heat= Above Peak | | scoville = 15,000,000–16,000,000 | ||
}} | }} | ||
المراجعة الحالية بتاريخ 14:02، 19 نوفمبر 2017
كابسيسين | |
---|---|
(6E)-N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methylnon-6-enamide | |
Other names (E)-N-(4-Hydroxy-3-methoxybenzyl)-8-methylnon-6-enamide | |
المعرفات | |
رقم CAS | |
بوبكيم (PubChem) | |
ChemSpider | 1265957 |
UNII | S07O44R1ZM |
EC number | 206-969-8 |
KEGG | C06866 |
ChEBI | CHEBI:3374 |
ChEMBL | CHEMBL294199 |
IUPHAR ligand | 2486 |
Jmol-3D images | Image 1 |
| |
| |
الخصائص | |
الصيغة الجزيئية | C18H27NO3 |
كتلة مولية | 305.4 g mol-1 |
المظهر | crystalline white powder[1] |
Odor | highly volatile and pungent |
نقطة الانصهار |
62 to 65 °C, خطأ في التعبير: كلمة لم نتعرف عليها «to». K, خطأ في التعبير: كلمة لم نتعرف عليها «to». °F |
نقطة الغليان |
210 to 220 °C, خطأ في التعبير: كلمة لم نتعرف عليها «to». K, خطأ في التعبير: كلمة لم نتعرف عليها «to». °F |
قابلية الذوبان في الماء | 0.0013 g/100 mL |
قابلية الذوبان | soluble in alcohol, ether, benzene slightly soluble in CS2, HCl, petroleum |
Vapor pressure | 1.32×10−8 قالب:Val/units at 25 قالب:Val/units[2] |
λmax | 280 nm |
Structure | |
Crystal structure | monoclinic |
Pharmacology | |
كود ATC | M02 |
Licence data | EU |
المخاطر | |
R-phrases | R24/25 |
S-phrases | S26, S36/37/39, S45 |
Main hazards | Toxic (T) |
NFPA 704 | |
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال) |
كابسيسين | |
---|---|
Heat | Above Peak |
Scoville scale | 15,000,000–16,000,000 SHU |
كابسيسين (بالإنجليزية: Capsaicin) واسمه العلمي "8-ميثيل-N-فانيلايل-6-نونيناميد" وصيغته الجزيئية هي ((CH3)sub>2CHCH=CH(CH2)sub>4CONHCH2C6H3-4-(OH)-3-(OCH3)) هو المركب النشط في الفلفل الحار. و،. والكابسيسين النقي مادة عديمة اللون والرائحة كما أنه كاره للماء. تتراوح قوة الكابسايسين النقي التي تمنح الفلفل الحار طعمه الحارق بين 15 مليون و16 مليون وحدة سكوفيل.
الإستعمالات
هو مادة مثيرة للثدييات بما فيها البشر
السمية
ينتج شعور بالحرق في أي نسيج يلامسه.
انظر أيضا
مراجع
وصلات خارجية
- Capsaicin Technical Fact Sheet - National Pesticide Information Center
- EPA Capsaicin Reregistration Eligibility Decision Fact Sheet
- Molecule of the Month
- European Commission, opinion of the Scientific Committee on Food on capsaicin.
- Fire and Spice: The molecular basis for flavor
- A ويكي هاو article on How to Cool Chilli Pepper Burns.