تيروسين

من موسوعة العلوم العربية
(بالتحويل من L-Tyrosine)
اذهب إلى: تصفح، ابحث
تيروسين
Skeletal formula of the L-isomer
Ball-and-stick model of the L-isomer as a zwitterion
المعرفات
رقم CAS 60-18-4
PubChem 1153
ChemSpider 5833 YesY
DrugBank DB03839
ChEBI CHEBI:58315
ChEMBL CHEMBL925 YesY
SMILES

InChI InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1
الخصائص
الصيغة الجزيئية C9H11NO3
كتلة مولية 181.17 g mol-1
المخاطر
NFPA 704
NFPA 704.svg
1
1
0
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)</small>

التايروسين أو تيروسين، (Tyrosine) هو واحدٌ من الحوامض الأمينية المعروفة والمهمّة بالنسبة للإنسان، وهو موجودٌ في معظم البروتينات؛ ويستخدمه الجسم البشريّ لإنتاج عِدّة أنواع من الهورمونات مثل النورادرينالين الأدرينالين.

يمكن فسفرة التيروسين من قِبل كينازات عديدةٍ من ضمنها عائلات كينازات السارك Src والسيك Syk.

مراجع


العائلات الرئيسية من المركبات الحيوية ؛؛؛ ببتيدات | الحموض الأمينية | حموض نووية | كاربوهيدرات | ليبيديات | تيربينات | كاروتينويدات | تيترابيرولات | عوامل مرافقة أنزيمية | ستيرويدات | فلافونيدات | قلويدات | بوليكيتيدات | غليكوزيدات
الحموض الأمينية ، الشائعة، العشرين : ألانين (ص.ب.) | أرجنين (ص.ب.) | أسباراجين (ص.ب.) | حمض الأسبارتيك (ص.ب.) | سيستئين (ص.ب.) | حمض الجلوتاميك (ص.ب.) | جلوتامين (ص.ب.) | جليسين (ص.ب.) | هيستيدين (ص.ب.) | آيسولوسين (ص.ب.) | لوسين (ص.ب.) | ليسين (ص.ب.) | ميثيونين (ص.ب.) | فينيلألانين (ص.ب.) | برولين (ص.ب.) | سيرين (ص.ب.) | ثريونين (ص.ب.) | تريبتوفان (ص.ب.) | تيروسين (ص.ب.) | فالين (ص.ب.)

قالب:أحماض أمينية

قالب:بذرة كيمياء حيوية