
من موسوعة العلوم العربية
مراجعة 18:08، 24 يوليو 2013 بواسطة كنان الطرح (نقاش | مساهمات) (أنشأ الصفحة ب'{{Drugbox | English = Cadralazine | verifiedrevid = 443300058 | IUPAC_name = ethoxy-''N'''-{6-[ethyl(2-hydroxypropyl)amino]pyridazin-3-yl}carbohydrazide | image = Cadral...')
(فرق) → مراجعة أقدم | المراجعة الحالية (فرق) | مراجعة أحدث ← (فرق)
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | English = Cadralazine | verifiedrevid = 443300058 | IUPAC_name = ethoxy-N'-{6-[ethyl(2-hydroxypropyl)amino]pyridazin-3-yl}carbohydrazide | image = Cadralazine.png | image2 = Cadralazine-3D-spacefill.png | alt2 = Cadralazine molecule

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 64241-34-5 | ATC_prefix = C02 | ATC_suffix = DB04 | PubChem = 2515 | DrugBank_Ref =  قالب:علامة اختيار | DrugBank = | UNII_Ref =  YesY | UNII = 8T96I3U713 | ChemSpiderID = 2420 | chemical_formula = C12H21N5O3 | molecular_weight = 283.327 | smiles = O=C(OCC)NNc1nnc(N(CC(O)C)CC)cc1 | InChI = 1/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19) | InChIKey = QLTVVOATEHFXLT-UHFFFAOYAD | StdInChI = 1S/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19) | StdInChIKey = QLTVVOATEHFXLT-UHFFFAOYSA-N

| C=12 | H=21 | N=5 | O=3 | molecular_weight = 283.33 g/mol }} كادرالازين (Cadralazine) خافض ضغط ينتمي إلى زمرة hydrazinophthalazine.


فموياً: 5 و10 و20 ملغ.

الحرائك الدوائية

  • الحد الأقصى لمستويات البلازما بعد تناوله فموياً بجرعة 5 ملغ بين 0.25-1 ساعة يتراوح بين 69.8 إلى 210 نانو غرام/غرام.

148.9 - 333.3 نانوغرام/غرام بعد جرعة 10 ملغ.

292.9 - 474.5 نانوغرام/غرام بعد جرعة 20 ملغ.

  • الإطراح الكلوي بدون تغيير: يصل إلى 69-73٪ من الجرعة.
  • العمر النصفي في البلازما: 2.5 ساعة.
  • التصفية الكلوية: 185-216 مل/دقيقة و251-295 مل/دقيقة، على التوالي.

