الفرق بين المراجعتين ل"مورنيفلومات"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
 
(لا فرق)

المراجعة الحالية بتاريخ 16:43، 24 ديسمبر 2013

{{Drugbox | Watchedfields = changed | verifiedrevid = 444424085 | IUPAC_name = 2-morpholin-4-ylethyl 2-{[3-(trifluoromethyl)phenyl]amino}nicotinate | image = morniflumate.png

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 65847-85-0 | ATC_prefix = M01 | ATC_suffix = AX22 | PubChem = 72106 | DrugBank_Ref =  قالب:علامة اختيار | DrugBank = | ChemSpiderID_Ref =  YesY | ChemSpiderID = 65089 | UNII_Ref =  YesY | UNII = R133MWH7X1 | KEGG_Ref =  YesY | KEGG = D05078

| C=19 | H=20 | F=3 | N=3 | O=3 | molecular_weight = 395.37561 g/mol | smiles = FC(F)(F)c1cc(ccc1)Nc2ncccc2C(=O)OCCN3CCOCC3 | InChI = 1/C19H20F3N3O3/c20-19(21,22)14-3-1-4-15(13-14)24-17-16(5-2-6-23-17)18(26)28-12-9-25-7-10-27-11-8-25/h1-6,13H,7-12H2,(H,23,24) | InChIKey = LDXSPUSKBDTEKA-UHFFFAOYAK | StdInChI_Ref =  YesY | StdInChI = 1S/C19H20F3N3O3/c20-19(21,22)14-3-1-4-15(13-14)24-17-16(5-2-6-23-17)18(26)28-12-9-25-7-10-27-11-8-25/h1-6,13H,7-12H2,(H,23,24) | StdInChIKey_Ref =  YesY | StdInChIKey = LDXSPUSKBDTEKA-UHFFFAOYSA-N }}

مورنيفلومات Morniflumate مضاد التهاب لا ستيروئيدي.