
من موسوعة العلوم العربية
مراجعة 14:05، 27 مايو 2013 بواسطة كنان الطرح (نقاش | مساهمات) (←‏المصادر)
(فرق) → مراجعة أقدم | المراجعة الحالية (فرق) | مراجعة أحدث ← (فرق)
اذهب إلى التنقل اذهب إلى البحث

{{Drugbox | English = Ketanserin | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 420466712 | IUPAC_name = 3-{2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl}quinazoline-2,4(1H,3H)-dione | image = Ketanserin.png

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CASNo_Ref =  YesY | CAS_number_Ref =  YesY | CAS_number = 74050-98-9 | ATC_prefix = C02 | ATC_suffix = KD01 | ATC_supplemental = QD03AX90 | PubChem = 3822 | IUPHAR_ligand = 88 | DrugBank_Ref =  قالب:علامة اختيار | DrugBank = | ChemSpiderID_Ref =  YesY | ChemSpiderID = 3690 | UNII_Ref =  YesY | UNII = 97F9DE4CT4 | KEGG_Ref =  YesY | KEGG = D02363 | ChEBI_Ref =  YesY | ChEBI = 6123 | ChEMBL_Ref =  YesY | ChEMBL = 51

| chemical_formula = | C=22 | H=22 | F=1 | N=3 | O=3 | molecular_weight = 395.43 g/mol | smiles = c1ccc2c(c1)c(=O)n(c(=O)[nH]2)CCN3CCC(CC3)C(=O)c4ccc(cc4)F | InChI = 1/C22H22FN3O3/c23-17-7-5-15(6-8-17)20(27)16-9-11-25(12-10-16)13-14-26-21(28)18-3-1-2-4-19(18)24-22(26)29/h1-8,16H,9-14H2,(H,24,29) | InChIKey = FPCCSQOGAWCVBH-UHFFFAOYAA | StdInChI_Ref =  YesY | StdInChI = 1S/C22H22FN3O3/c23-17-7-5-15(6-8-17)20(27)16-9-11-25(12-10-16)13-14-26-21(28)18-3-1-2-4-19(18)24-22(26)29/h1-8,16H,9-14H2,(H,24,29) | StdInChIKey_Ref =  YesY | StdInChIKey = FPCCSQOGAWCVBH-UHFFFAOYSA-N }} كيتانسيرين (Ketanserin) ينتمي إلى فئة من مضادات السيروتونين. المستخدمة في علاج ارتفاع ضغط الدم.

آلية العمل

كيتانسيرين مناهض للسيروتونين والذي يرتبط مع المستقبلات الطرفية للسيروتونين -2 (5HT2) مما يؤدي إلى تثبيط فعل السيروتونين مما يسبب تضيق الأوعية الدموية، تضيق قصبي، صفيحي.

الحركية الدوائية

بداية التأثير

1-2 دقيقة (IV).

مدة التأثير

30-60 دقيقة (IV).


يُمتص بسرعة من الجهاز الهضمي (عن طريق الفم).

التوافر الحيوي

يصل حوالي 50٪ إلى ذروة التركيز البلازمي بعد 30-120 دقيقة.


95٪ مرتبط بالبروتينات، قد يعبر المشيمة، وقد يوجد قليلاً في حليب الثدي.




  • عن طريق البول (68٪ من الجرعة الفموية).
  • عبر البراز (24٪)، أغلبهم من الاستقلاب.


لمعالجة ارتفاع ضغط الدم

  • فموياً:

الكبار: 20 ملغ مرتين/يوم، وتزاد إلى 40 ملغ مرتين/يوم بعد 2-4 أسبوع حسب الحاجة.

  • وريدياً: يمكن أن تعطى عن طريق الوريد / IM.

للاختلال الكبدي أو التليف الكبدي: يجب خفض الجرعة أو زيادة الفاصل الزمني بين الجرعات.

للاختلال الكبدي الحاد: الحد الأقصى المسموح به 20 ملغ.

ردود فعل سلبية للدواء

تعب، دوار، دوخة، صداع، جفاف الفم، اضطرابات في الجهاز الهضمي، وذمة، عدم انتظام ضربات القلب البطيني.

التفاعلات والتداخلات الدوائية

تتعزز آثار انخفاض الضفط باستخدام مدرات البول وخافضات الضغط الأخرى.

احتياطات خاصة

  • إطالة زمن الـ QT
  • قد يُضعف القدرة على القيادة أو تشغيل الآليات.

