الفرق بين المراجعتين ل"غليسيرو فوسفات الكالسيوم"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب''''غليسيرو فوسفات الكالسيوم Calcium Glycero phosphate''' ==الصيغة الكيميائية== C3H7CaO6P ==الوصف Characters== مسحوق أب...')
 
 
(مراجعة متوسطة واحدة بواسطة نفس المستخدم غير معروضة)
سطر 1: سطر 1:
 +
{{Chembox
 +
| verifiedrevid = 443495906
 +
| ImageFile = calcium glycerylphosphate.png
 +
|  ImageSize = 200px
 +
|  ImageAlt =
 +
|  IUPACName = Calcium 1,3-dihydroxypropan-2-yl phosphate
 +
| OtherNames =
 +
| Section1 = {{Chembox Identifiers
 +
|  CASNo = 27214-00-2
 +
|  CASNo_Ref = {{cascite|correct|??}}
 +
|  PubChem = 62820
 +
|  ChEBI_Ref = {{ebicite|correct|EBI}}
 +
| ChEBI = 31336
 +
| SMILES = [Ca+2].[O-]P([O-])(=O)OC(CO)CO
 +
|  ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 +
|  ChemSpiderID = 56554
 +
|  InChI = 1/C3H9O6P.Ca/c4-1-3(2-5)9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2
 +
|  InChIKey = UHHRFSOMMCWGSO-NUQVWONBAR
 +
|  StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 +
|  StdInChI = 1S/C3H9O6P.Ca/c4-1-3(2-5)9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2
 +
|  StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 +
|  StdInChIKey = UHHRFSOMMCWGSO-UHFFFAOYSA-L
 +
|  ATCvet =
 +
|  ATCCode_prefix = A12
 +
|  ATCCode_suffix = AA08
 +
|  ATC_Supplemental =
 +
}}
 +
| Section2 = {{Chembox Properties
 +
|  C=3|H=7|Ca=1|O=6|P=1
 +
|  Appearance =
 +
|  Density =
 +
|  MeltingPt =
 +
|  BoilingPt =
 +
|  Solubility = }}
 +
| Section3 = {{Chembox Hazards
 +
|  MainHazards =
 +
|  FlashPt =
 +
|  Autoignition = }}
 +
}}
 +
 
'''غليسيرو فوسفات الكالسيوم Calcium Glycero phosphate'''
 
'''غليسيرو فوسفات الكالسيوم Calcium Glycero phosphate'''
  
سطر 15: سطر 55:
 
==الاستعمالUse==
 
==الاستعمالUse==
 
*[[سواغ]] صيدلاني Pharmaceutical aid.
 
*[[سواغ]] صيدلاني Pharmaceutical aid.
*تنظيم نقص ال[[كالسيوم]]، وأمراض عوز الكالسيوم، والمغص، والأمراض العظمية والورم الجزيري والتسمم بال[[فلورايد]].
+
*[[مكمل معدني]]: تنظيم نقص ال[[كالسيوم]]، وأمراض عوز الكالسيوم، والمغص، والأمراض العظمية والورم الجزيري والتسمم بال[[فلورايد]].
  
 
==الحفظ والتخزين Packaging and Storage==
 
==الحفظ والتخزين Packaging and Storage==
سطر 25: سطر 65:
 
*[[دساتير الأدوية]]
 
*[[دساتير الأدوية]]
  
 +
{{مكملات معادن}}
 
{{سواغ}}
 
{{سواغ}}
 
{{بذرة}}
 
{{بذرة}}
[[تصنيف:صيدلة]]
+
 
[[تصنيف:مواد صيدلانية]]
+
[[تصنيف:أدوية]]
 +
[[تصنيف:موسوعة الأدوية]]
 +
[[تصنيف:مكملات معادن]]
 
[[تصنيف:سواغ]]
 
[[تصنيف:سواغ]]
 +
[[تصنيف:كيمياء]]

المراجعة الحالية بتاريخ 09:39، 28 سبتمبر 2013

غليسيرو فوسفات الكالسيوم
{{{Alt}}}
المعرفات
رقم CAS 27214-00-2
بوبكيم (PubChem) 62820
ChemSpider 56554 YesY
ChEBI CHEBI:31336
كود ATC A12AA08
Jmol-3D images Image 1
الخصائص
الصيغة الجزيئية C3H7CaO6P
كتلة مولية 210.1 g mol-1
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

غليسيرو فوسفات الكالسيوم Calcium Glycero phosphate

الصيغة الكيميائية

C3H7CaO6P

الوصف Characters

مسحوق أبيض جاذب للرطوبة، عديم الطعم والرائحة.

الانحلالية Solubility

الاستعمالUse

الحفظ والتخزين Packaging and Storage

يحفظ في مكان جاف وبارد ضمن أوعية مغلقة.


المصدر