الفرق بين المراجعتين ل"صفصافات الفينيل"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب'تملك '''صفصافات الفينيل Phenyl salicylate'''، وتدعى أيضاً سالول، خصائص طبية متعددة. يمكن أن تكون بمثابة...')
(مراجعتان متوسطتان بواسطة نفس المستخدم غير معروضتين)
سطر 1: سطر 1:
{{فضل الكاتب الرئيسي|Kinda Sh }}
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 412457168
| Reference = <ref name="Merck">''Merck Index'', 11th Edition, '''7282'''.</ref>
| ImageFile = Phenyl salicylate.svg
| ImageSize = 180px
| ImageName = Skeletal formula
| ImageFile1 = Phenyl-salicylate-3D-balls-B.png
| ImageSize1 = 200px
| ImageName1 = Ball-and-stick model
| IUPACName = Phenyl 2-hydroxybenzoate
| OtherNames = Salol
| Section1 = {{Chembox Identifiers
| Abbreviations =
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 118-55-8
| PubChem = 8361
| SMILES = O=C(Oc2ccccc2)c1c(O)cccc1
| InChI =
| MeSHName =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1339216
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
| ATCCode_prefix = G04
| ATCCode_suffix = BX12
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties
| Formula = C<sub>13</sub>H<sub>10</sub>O<sub>3</sub>
| MolarMass = 214.22 g/mol
| Appearance = White solid
| Density = 1.25 g/cm<sup>3</sup>
| MeltingPtC = 41.5
| Melting_notes =
| BoilingPtC = 173
| Boiling_notes = at 12 mmHg
| Solubility = 1 g/6670 mL
| SolubleOther =
| Solvent =
| pKa =
| pKb =
| Section7 = {{Chembox Hazards
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| PEL = }}
تملك '''صفصافات الفينيل Phenyl salicylate'''، وتدعى أيضاً سالول، خصائص طبية متعددة. يمكن أن تكون بمثابة مسكن، أي أنها تخفف الألم، وكمضاد جرثومي، أي لها خصائص مضادة للجراثيم، وكخافض حرارة، أي يمكن استخدامها لعلاج ال[[حمى]].
تملك '''صفصافات الفينيل Phenyl salicylate'''، وتدعى أيضاً سالول، خصائص طبية متعددة. يمكن أن تكون بمثابة مسكن، أي أنها تخفف الألم، وكمضاد جرثومي، أي لها خصائص مضادة للجراثيم، وكخافض حرارة، أي يمكن استخدامها لعلاج ال[[حمى]].
سطر 20: سطر 84:
{{ثبت المراجع}} 
{{أدوية الجهاز البولي، متضمنة مضادات التشنج}}
{{أدوية الجهاز البولي، متضمنة مضادات التشنج}}
[[تصنيف:موسوعة الأدوية]]
[[تصنيف:موسوعة الأدوية]]
[[تصنيف:الأدوية البولية ومضادات التشنج]]
[[تصنيف:الأدوية البولية ومضادات التشنج]]

المراجعة الحالية بتاريخ 22:42، 19 نوفمبر 2013

Kinda Sh
المساهمة الرئيسية في هذا المقال
صفصافات الفينيل[1]
رقم CAS 118-55-8
بوبكيم (PubChem) 8361
كود ATC G04BX12
Jmol-3D images Image 1
صيغة جزيئية C13H10O3
الكتلة المولية 214.22 g/mol
المظهر White solid
الكثافة 1.25 g/cm3
نقطة الانصهار

41.5 °C, 315 K, 107 °F

نقطة الغليان

173 °C, 446 K, 343 °F (at 12 mmHg)

قابلية الذوبان في الماء 1 g/6670 mL
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

تملك صفصافات الفينيل Phenyl salicylate، وتدعى أيضاً سالول، خصائص طبية متعددة. يمكن أن تكون بمثابة مسكن، أي أنها تخفف الألم، وكمضاد جرثومي، أي لها خصائص مضادة للجراثيم، وكخافض حرارة، أي يمكن استخدامها لعلاج الحمى.


تتضمن بعض الاستخدامات الطبية لصفصافات الفينيل استخدامها كمطهر خارجي، ومادة فعالة في الواقيات الشمسية، ودواء فموي لعلاج ألم التهاب المسالك البولية. يمكن أيضاً أن توجد في التغليف المعوي للحبوب ويمكن مزجها مع الكحول أو الشحوم لإيجاد علاج موضعي للالتهاب.

يتم إنتاج مادة صفصافات الفينيل عن طريق تفاعل كيميائي بين الفينول، وهو مركب عضوي، وحمض الصفصاف، وهو حمض عضوي تم اكتشافه واستخراجه بالأصل من شجرة الصفصاف. إن حمض الصفصاف أيضاً من مكونات أستيل حمض الصفصاف والذي هو عنصر فعال في الأدوية المسكنة للألم والحرارة مثل الأسبرين.

بعد اكتشاف صفصافات الفينيل في أواخر القرن التاسع عشر، كان كثيراً ما يتم إدخالها كبديل لأستيل حمض الصفصاف. لم تعد تستخدم بشكل شائع في الطب البشري، رغم أنها ما تزال تستخدم في الطب البيطري. على المرأة الحامل أو المرضع أن تتجنب استخدام أية منتجات حاوية على هذه المادة بسبب المخاطر المحتملة على الجنين أو الطفل.

في الماضي، كانت صفصافات الفينيل تستخدم في معالجة الالحمى الرثوية وكدواء داخلي مضاد للجراثيم يتم تناوله لعلاج حالات كالإسهال. ما زالت تستخدم كمكون في بعض الأدوية الفموية المتاحة بوصفة طبية للمرضى الذين يعانون من التهاب المسالك البولية السفلى. لا يمكنها علاج هذا النوع من الالتهاب، لكن يمكنا أن تخفف الألم.


هذه المادة في حالتها الأصلية ناعمة جداً، مسحوق بللوري أبيض. إنها ليست منحلة في الماء ، ولهذا السبب تستعمل أحياناً كمكون في التغليف المعوي للأقراص الطبية والكبسولات والحبوب. يساعد التغليف المعوي في إبطاء تحرر المادة الدوائية الموجودة في المستحضر الفموي بحيث يمكن أن يتم امتصاصها بشكل أفضل من قبل الجسم. ومع ذلك، عدم انحلال صفصافات الفينيل في الماء يجعلها أيضاً صعبة الامتصاص من قبل الجسم، مما يقلل من فعالية الدواء.

صفصافات الفينيل منحلة في الكحول، وفي بعض المنتجات الطبية تُمزج بأنواع متعددة من الكحول، مثل الغول الإيثيلي أو البروبيلين غليكول. يمكن أيضاً أن يتم مزجها بالدهون والزيوت، كالفازلين، أو زيت الغار، أو الأوجينول، وهي مادة مشتقة من الزيوت العطرية.

عادةً يراد من المركبات الحاوية على صفصافات الفينيل الممزوج بالزيت أو الغول أن تستخدم خارجياً، مثلاً لعلاج التهاب وعدوى الجلد.



  1. Merck Index, 11th Edition, 7282.