الفرق بين المراجعتين ل"سيتراكسات"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب''''سيتراكسات Cetraxate''' هو داواء فموي كمضاد للقرحة ولعلاج ال[[ارتداد معدي مريئي|ارتد...')
 
 
سطر 1: سطر 1:
'''سيتراكسات Cetraxate''' هو داواء فموي كمضاد لل[[قرحة هضمية|قرحة]] ولعلاج ال[[ارتداد معدي مريئي|ارتداد المعدي المريئي]] والذي له أثر وقائي خلوي cytoprotective.
+
{{Drugbox
 +
| English = Cetraxate
 +
| IUPAC_name = 3-[4-[4-(aminomethyl)cyclohexanecarbonyl]oxyphenyl]propanoic acid
 +
| image = Cetraxate.png
 +
 
 +
<!--Clinical data-->
 +
| tradename = 
 +
| Drugs.com = {{drugs.com|international|cetraxate}}
 +
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
 +
| pregnancy_US = <!-- A / B            / C / D / X -->
 +
| pregnancy_category = 
 +
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
 +
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
 +
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
 +
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
 +
| legal_status = Rx-only
 +
| routes_of_administration = Oral
  
 +
<!--Pharmacokinetic data-->
 +
| bioavailability = 
 +
| protein_bound = 
 +
| metabolism = 
 +
| elimination_half-life = 
 +
| excretion = 
  
[[ملف:220px-Cetraxate.png|تصغير|يسار]]
+
<!--Identifiers-->
 +
| CAS_number = 34675-84-8
 +
| ATC_prefix = none
 +
| ATC_suffix = 
 +
| ATC_supplemental = 
 +
| PubChem = 2680
 +
| DrugBank = 
 +
| ChemSpiderID = 2579
 +
| UNII_Ref = {{fdacite|correct|FDA}}
 +
| UNII = 5VPA8CPF0N
 +
| KEGG = D07663
 +
| ChEMBL = 502896
  
 +
<!--Chemical data-->
 +
| chemical_formula = 
 +
| C=17 | H=23 | N=1 | O=4
 +
| molecular_weight = 305.36 g/mol
 +
| smiles = O=C(O)CCc2ccc(OC(=O)C1CCC(CN)CC1)cc2
 +
| InChI = 1/C17H23NO4/c18-11-13-1-6-14(7-2-13)17(21)22-15-8-3-12(4-9-15)5-10-16(19)20/h3-4,8-9,13-14H,1-2,5-7,10-11,18H2,(H,19,20)
 +
| InChIKey = FHRSHSOEWXUORL-UHFFFAOYAE
 +
}}
 +
'''سيتراكسات Cetraxate''' هو داواء فموي كمضاد لل[[قرحة هضمية|قرحة]] ولعلاج ال[[ارتداد معدي مريئي|ارتداد المعدي المريئي]] والذي له أثر وقائي خلوي cytoprotective.
  
 
{{بذرة}}
 
{{بذرة}}
 
{{أدوية القرحة والقلس المريئي}}
 
{{أدوية القرحة والقلس المريئي}}
 
 
[[تصنيف:أدوية]]
 
[[تصنيف:أدوية]]
 
[[تصنيف:موسوعة الأدوية]]
 
[[تصنيف:موسوعة الأدوية]]
 
[[تصنيف:مضادات القرحة]]
 
[[تصنيف:مضادات القرحة]]
[[تصنيف:أخرى]]
 

المراجعة الحالية بتاريخ 22:13، 9 أغسطس 2013

سيتراكسات
Systematic (IUPAC) name
3-[4-[4-(aminomethyl)cyclohexanecarbonyl]oxyphenyl]propanoic acid
Clinical data
AHFS/Drugs.com International Drug Names
Pregnancy cat. ?
Legal status Prescription only
Routes Oral
Identifiers
CAS number 34675-84-8
ATC code None
PubChem CID 2680
ChemSpider 2579
UNII 5VPA8CPF0N YesY
KEGG D07663
ChEMBL CHEMBL502896
Chemical data
Formula C17H23NO4 
Mol. mass 305.36 g/mol

سيتراكسات Cetraxate هو داواء فموي كمضاد للقرحة ولعلاج الارتداد المعدي المريئي والذي له أثر وقائي خلوي cytoprotective.